| Company Name: |
BeiJing Hwrk Chemicals Limted
|
| Tel: |
0757-86329057 18934348241 |
| Email: |
sales4.gd@hwrkchemical.com |
| Products Intro: |
Product Name:3-Chloro-10H-phenothiazine
CAS:1207-99-4
Purity:97+% Package:5g Remarks:HWG49456
|
| Company Name: |
Zhengzhou Huiju Chemical Co., Ltd.
|
| Tel: |
0371-55900031 18137872243 |
| Email: |
2853979815@qq.com |
| Products Intro: |
Product Name:3-Chloro-10H-phenothiazine
CAS:1207-99-4
Purity:98% Package:1g
|
|
| | 3-chloro-10H-phenothiazine Basic information |
| | 3-chloro-10H-phenothiazine Chemical Properties |
| InChI | InChI=1S/C12H8ClNS/c13-8-5-6-10-12(7-8)15-11-4-2-1-3-9(11)14-10/h1-7,14H | | InChIKey | DPUVPRWTWNQSOS-UHFFFAOYSA-N | | SMILES | C1=C2C(SC3=C(N2)C=CC=C3)=CC(Cl)=C1 | | EPA Substance Registry System | 10H-Phenothiazine, 3-chloro- (1207-99-4) |
| | 3-chloro-10H-phenothiazine Usage And Synthesis |
| Uses | 3-Chloro-10H-phenothiazine is a derivative of Phenothiazine (P318040). Phonothiazine derivatives are used in dyes and pharmaceuticals, and as additives for lubricants and polymers. |
| | 3-chloro-10H-phenothiazine Preparation Products And Raw materials |
|