|
|
| | phenalene Basic information |
| Product Name: | phenalene | | Synonyms: | phenalene;peri-benznaphthalene;Benzonaphthene;Perinaphthene;Perinaphthindene;peri-Naphthindene;1H-Phenalene | | CAS: | 203-80-5 | | MF: | C13H10 | | MW: | 166.22 | | EINECS: | 205-907-7 | | Product Categories: | | | Mol File: | 203-80-5.mol |  |
| | phenalene Chemical Properties |
| Melting point | 159-160 °C(Solv: ethanol (64-17-5)) | | Boiling point | 70 °C(Press: 0.01 Torr) | | density | 1.139±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C13H10/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12/h1-8H,9H2 | | InChIKey | XDJOIMJURHQYDW-UHFFFAOYSA-N | | SMILES | C1C2C3C(C=CC=2)=CC=CC=3C=C1 | | EPA Substance Registry System | 1H-Phenalene (203-80-5) |
| | phenalene Usage And Synthesis |
| Definition | ChEBI: Phenalene is an ortho- and peri-fused polycyclic arene and an ortho- and peri-fused tricyclic hydrocarbon. |
| | phenalene Preparation Products And Raw materials |
|