| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | Perfluoro-n-[1,2,3,4-13C4]octanoic Acid
DISCONTINUED Basic information |
| Product Name: | Perfluoro-n-[1,2,3,4-13C4]octanoic Acid
DISCONTINUED | | Synonyms: | Perfluoro-n-[1,2,3,4-13C4]octanoic Acid
DISCONTINUED;Perfluoro-n-[1,2,3,4-13C4]octanoic acid;Perfluorooctanoic acid-[13C4;13C4-PFOA in Methanol;Perfluoro-n-[1.2.3.4-13C4]octanoic acid in Methanol;Octanoic-1,2,3,4-13C4 acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-;Perfluorooctanoic acid 13C4 (1,2,3,4-13C4);EPA Method 1633 NIS Mixture 0.25-1 μg/mL in Methanol:Water | | CAS: | 960315-48-4 | | MF: | C8HF15O2 | | MW: | 418.04 | | EINECS: | | | Product Categories: | | | Mol File: | 960315-48-4.mol | ![Perfluoro-n-[1,2,3,4-13C4]octanoic Acid
DISCONTINUED Structure](CAS/20240320/GIF/960315-48-4.gif) |
| | Perfluoro-n-[1,2,3,4-13C4]octanoic Acid
DISCONTINUED Chemical Properties |
| density | 1.745±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | InChI | InChI=1S/C8HF15O2/c9-2(10,1(24)25)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23/h(H,24,25)/i1+1,2+1,3+1,4+1 | | InChIKey | SNGREZUHAYWORS-JCDJMFQYSA-N | | SMILES | C(F)(F)(C(F)(F)C(F)(F)C(F)(F)F)[13C](F)(F)[13C](F)(F)[13C](F)(F)[13C](=O)O |
| | Perfluoro-n-[1,2,3,4-13C4]octanoic Acid
DISCONTINUED Usage And Synthesis |
| Uses | Perfluoro-n-[1,2,3,4-13C4]octanoic Acid is a labeled compound of Perfluorooctanoic Acid (P286500) which is a persistent environmental pollutant, it can accumulate in human tissues via various exposure routes. |
| | Perfluoro-n-[1,2,3,4-13C4]octanoic Acid
DISCONTINUED Preparation Products And Raw materials |
|