|
|
| | 3-Bromo-5-Chlorobenzotrifluoride Basic information |
| Product Name: | 3-Bromo-5-Chlorobenzotrifluoride | | Synonyms: | 3-Bromo-5-Chlorobenzotrifluoride;1-Bromo-3-chloro-5-(trifluoromethyl)benzene;3-Chloro-5-trifluoromethylbromobenzene;1-Bromo-3-chloro-5-(trifluoromethyl)benzene, 3-Bromo-5-chloro-alpha,alpha,alpha-trifluorotoluene;3-BroMo-5-chlorobenzotrifluoride, 97%+;3-chloro-5-bromo trifluoromethylbenzene;Benzene, 1-bromo-3-chloro-5-(trifluoromethyl)-;afoxolaner-010 | | CAS: | 928783-85-1 | | MF: | C7H3BrClF3 | | MW: | 259.45 | | EINECS: | 200-100-8 | | Product Categories: | | | Mol File: | 928783-85-1.mol |  |
| | 3-Bromo-5-Chlorobenzotrifluoride Chemical Properties |
| Boiling point | 182℃ | | density | 1.717 | | Fp | 64℃ | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H3BrClF3/c8-5-1-4(7(10,11)12)2-6(9)3-5/h1-3H | | InChIKey | QRPRXRQFNNXPBA-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(C(F)(F)F)=CC(Cl)=C1 |
| | 3-Bromo-5-Chlorobenzotrifluoride Usage And Synthesis |
| Chemical Properties | light yellow liquid | | Uses | 3-Bromo-5-chlorobenzotrifluoride is a polyhalogenated benzene derivative containing reactive groups chlorine, bromine and fluorine atoms in its structure. It is mainly used as an organic synthetic raw material or pharmaceutical intermediate compound. It can be used in the preparation of anti-infective agents such as Lpxh inhibitors or fumarate derivatives. |
| | 3-Bromo-5-Chlorobenzotrifluoride Preparation Products And Raw materials |
|