|
|
| | Methyl 5-bromo-2-chloroisonicotinate Basic information |
| Product Name: | Methyl 5-bromo-2-chloroisonicotinate | | Synonyms: | Methyl 5-bromo-2-chloropyridine-4-carboxylate, 5-Bromo-2-chloro-4-(methoxycarbonyl)pyridine;4-Pyridinecarboxylic acid, 5-broMo-2-chloro-, Methyl ester;5-Bromo-2-chloro-4-pyridinecarboxylic acid methyl ester;Methyl 5-bromo-2-chloroisonicotite;5-bromo-2-chloro-pyridin-4-carboxylic acid methyl ester;Methyl 5-bromo-2-chloroisonicotinate;Methyl 5-bromo-2-chloropyridine-4-carboxylate;Methyl 5-bromo-2-chloroisonicotinate 98% | | CAS: | 886365-28-2 | | MF: | C7H5BrClNO2 | | MW: | 250.48 | | EINECS: | | | Product Categories: | blocks;Bromides;Carboxes;Pyridines | | Mol File: | 886365-28-2.mol |  |
| | Methyl 5-bromo-2-chloroisonicotinate Chemical Properties |
| Boiling point | 286.5±35.0℃ (760 Torr) | | density | 1.684±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | 127.1±25.9℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -3.54±0.10(Predicted) | | Appearance | Off-white to light yellow Solid-liquid mixture | | InChI | InChI=1S/C7H5BrClNO2/c1-12-7(11)4-2-6(9)10-3-5(4)8/h2-3H,1H3 | | InChIKey | ZGVAWYBJGMOKBV-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(Br)C(C(OC)=O)=C1 |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2933399990 |
| | Methyl 5-bromo-2-chloroisonicotinate Usage And Synthesis |
| Synthesis | To a 5000 mL three-necked flask, add 3500 mL of the above already prepared methanol solution of hydrogen chloride, 350 g of 5-bromo-2-chloroisonicotinic acid, raise the temperature to 40C and stir the reaction, track the reaction by liquid chromatography, and stop the reaction when the product, methyl 5-bromo-2-chloroisonicotinate, is greater than 85% by liquid chromatography, and the content of the methyl 5-bromo-2-methoxyisonicotinate by-product (3) is less than 1%. Reaction. Neutralize the system with solid sodium bicarbonate to neutral under stirring, filter, drain, rinse the filter cake with methanol, combine the filtrates and concentrate to obtain a brownish-red liquid 320 g, high vacuum distillation, collect 40-60 Pa, 70-75 fractions, obtain a colorless liquid 5-bromo-2-chloroisonicotinic acid methyl ester (296 g), content of 98.9%. |
| | Methyl 5-bromo-2-chloroisonicotinate Preparation Products And Raw materials |
|