|
|
| | 1-Bromo-5-chloro-3-fluoro-2-iodobenzene Basic information | | Uses |
| | 1-Bromo-5-chloro-3-fluoro-2-iodobenzene Chemical Properties |
| Melting point | 106～107℃ | | Boiling point | 272℃ | | density | 2.331 | | Fp | 118℃ | | storage temp. | 2-8°C(protect from light) | | form | crystalline solid | | color | Brown | | InChI | InChI=1S/C6H2BrClFI/c7-4-1-3(8)2-5(9)6(4)10/h1-2H | | InChIKey | IKJUIUCZEXVZMB-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(Cl)=CC(F)=C1I |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2903998090 |
| | 1-Bromo-5-chloro-3-fluoro-2-iodobenzene Usage And Synthesis |
| Uses | 1-Bromo-5-chloro-3-fluoro-2-iodobenzene is useful in the preparation of a plurality of organic compounds for organic electronic devices. | | Uses | 1-Bromo-5-chloro-3-fluoro-2-iodobenzene is useful in the preparation of a plurality of organic compounds for organic electronic devices. |
| | 1-Bromo-5-chloro-3-fluoro-2-iodobenzene Preparation Products And Raw materials |
|