| Company Name: |
3B Pharmachem (Wuhan) International Co.,Ltd.
|
| Tel: |
821-50328103-801 18930552037 |
| Email: |
3bsc@sina.com |
| Products Intro: |
Product Name:B2;5-[4-(4-Chlorobenzoyl)-1-piperazinyl]-8-nitroquinoline CAS:115687-05-3 Purity:99% HPLC Package:1Mg ; 5Mg;10Mg ;100Mg;250Mg ;500Mg ;1g;2.5g ;5g ;10g
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Products Intro: |
Product Name:B2 CAS:115687-05-3 Purity:>=98% by HPLC Remarks:Reach out to us for more information about custom solutions.
|
CPNQ manufacturers
- B2
-
- $41.00 / 2mg
-
2026-05-11
- CAS:115687-05-3
- Min. Order:
- Purity: 99.66%
- Supply Ability: 10g
|
| Product Name: | CPNQ | | Synonyms: | 5-[4-(4-Chlorobenzoyl)-1-piperazinyl]-8-nitroquinoline;B2;Linazolamide intermediate B impurity 2;(4-chlorophenyl)-[4-(8-nitroquinolin-5-yl)piperazin-1-yl]methanone;SIRT2 Inhibitor, B2;Methanone, (4-chlorophenyl)[4-(8-nitro-5-quinolinyl)-1-piperazinyl]-;Sirtuin,Parkinson’s diseases,Huntington’s diseases,Inhibitor,B2,inhibit,B-2;SIRT2-IN-8 | | CAS: | 115687-05-3 | | MF: | C20H17ClN4O3 | | MW: | 396.83 | | EINECS: | | | Product Categories: | | | Mol File: | 115687-05-3.mol |  |
| Melting point | 174-176°C | | Boiling point | 645.5±55.0 °C(Predicted) | | density | 1.412±0.06 g/cm3(Predicted) | | storage temp. | Store at +4°C | | solubility | H2O: insoluble <2mg/mL | | form | solid | | pka | 2.30±0.29(Predicted) | | color | brown | | Water Solubility | H2O: insoluble <2mg/mL DMSO: >5mg/mL | | InChI | 1S/C20H17ClN4O3/c21-15-5-3-14(4-6-15)20(26)24-12-10-23(11-13-24)17-7-8-18(25(27)28)19-16(17)2-1-9-22-19/h1-9H,10-13H2 | | InChIKey | KLNPVNZJCWIQSK-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(N2CCN(CC2)C(=O)c3ccc(Cl)cc3)c4cccnc14 |
| Hazard Codes | T | | Risk Statements | 25-36/37/38 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Uses | B2 is a cell permeable inhibitor of SIRT2 (sirtuin 2). Multidrug resistance protein 4 (MRP4) inhibitor in tumors such as neuroblastoma and colorectal cancer. | | Definition | ChEBI: (4-chlorophenyl)-[4-(8-nitro-5-quinolinyl)-1-piperazinyl]methanone is a N-arylpiperazine. | | Biological Activity | Promotes inclusion formation in cellular models of Huntington's disease and Parkinson's disease. Prevents huntingtin-mediated proteasome dysfunction and reduces α -synuclein-mediated toxicity. | | IC 50 | SIRT2 |
| | CPNQ Preparation Products And Raw materials |
|