| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | R(-)-doi hydrochloride potent and select ive Basic information |
| Product Name: | R(-)-doi hydrochloride potent and select ive | | Synonyms: | (R)-(-)-2,5-dimethoxy-4-iodoamphetamine hydrochloride;(-)-2,5-Dimethoxy-4-iodoamphetamine hydrochloride, (-)-1-(2,5-Dimethoxy-4-iodophenyl)-2-aminopropane hydrochloride;(-)-2,5-Dimethoxy-4-iodoamphetamine hydrochloride
(R)(-)-DOI hydrochloride;(-)-1-(2,5-Dimethoxy-4-iodophenyl)-2-aminopropane Hydrochloride;(-)-2,5-Dimethoxy-4-iodoamphetamine hydrochloride;R(-)-doi hydrochloride potent and select ive | | CAS: | 82864-02-6 | | MF: | C11H16INO2.ClH | | MW: | 357.62 | | EINECS: | | | Product Categories: | | | Mol File: | 82864-02-6.mol |  |
| | R(-)-doi hydrochloride potent and select ive Chemical Properties |
| Melting point | 232 °C(Solv: isopropanol (67-63-0)) | | solubility | H2O: ≥20mg/mL | | form | solid | | pka | 9.89 | | color | white | | Optical Rotation | [α]22/D 12.36°, c = 2 in H2O(lit.) | | Water Solubility | H2O: ≥20mg/mL ethanol: soluble | | InChI | 1S/C11H16INO2.ClH/c1-7(13)4-8-5-11(15-3)9(12)6-10(8)14-2;/h5-7H,4,13H2,1-3H3;1H/t7-;/m1./s1 | | InChIKey | QVFDMWGKHUFODK-OGFXRTJISA-N | | SMILES | Cl.COc1cc(C[C@@H](C)N)c(OC)cc1I |
| RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 11 - Combustible Solids |
| | R(-)-doi hydrochloride potent and select ive Usage And Synthesis |
| Uses | (-)-1-(2,5-Dimethoxy-4-iodophenyl)-2-aminopropaneHydrochloride is a useful reagent in the stereospecific synthesis of amphetamines via multi-step reactions involving corresponding aryl propanol. | | Biochem/physiol Actions | Potent and selective 5-HT2 serotonin receptor agonist that crosses the blood-brain barrier; more potent enantiomer of ±-DOI hydrochloride. |
| | R(-)-doi hydrochloride potent and select ive Preparation Products And Raw materials |
|