|
| 4,4'-Bis(bromomethyl)biphenyl Basic information |
| 4,4'-Bis(bromomethyl)biphenyl Chemical Properties |
Melting point | 169.0 to 173.0 °C | Boiling point | 399.8±37.0 °C(Predicted) | density | 1.591±0.06 g/cm3(Predicted) | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly) | form | Solid | color | White to Off-White | BRN | 2444585 | InChI | InChI=1S/C14H12Br2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H,9-10H2 | InChIKey | HMUGRILXVBKBID-UHFFFAOYSA-N | SMILES | C1(C2=CC=C(CBr)C=C2)=CC=C(CBr)C=C1 | CAS DataBase Reference | 20248-86-6 |
| 4,4'-Bis(bromomethyl)biphenyl Usage And Synthesis |
Chemical Properties | Off-white powder | Uses | 4,4''-Bis(bromomethyl)-1,1''-biphenyl is a genotoxic impurity from valsartan antihypertensive drug. |
| 4,4'-Bis(bromomethyl)biphenyl Preparation Products And Raw materials |
|