|
|
| | 3-Hydroxyadamantane-1-acetic acid Basic information |
| | 3-Hydroxyadamantane-1-acetic acid Chemical Properties |
| Melting point | 125-129 °C | | Boiling point | 375.3±15.0 °C(Predicted) | | density | 1.329 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Methanol[soluble in] | | solubility | soluble in Methanol | | form | powder to crystaline | | pka | 4.72±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C12H18O3/c13-10(14)6-11-2-8-1-9(3-11)5-12(15,4-8)7-11/h8-9,15H,1-7H2,(H,13,14) | | InChIKey | JFMDWSCOQLUOCZ-UHFFFAOYSA-N | | SMILES | C12(CC(O)=O)CC3CC(CC(O)(C3)C1)C2 | | CAS DataBase Reference | 17768-36-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29162090 |
| | 3-Hydroxyadamantane-1-acetic acid Usage And Synthesis |
| Chemical Properties | Light yellow powder | | Uses | 3-Hydroxyadamantane-1-acetic acid is a derivative of adamantane. Its crystal structure has been analyzed through X-ray diffraction, revealing stabilization through intermolecular O-H...O hydrogen bonds that form a chain. The application of adamantane and its derivatives is widespread in medicine. For example, adamantaneamine has demonstrated efficacy in inhibiting influenza A virus exuviation and in easing Parkinsonian symptoms (Lu et al., 1996). |
| | 3-Hydroxyadamantane-1-acetic acid Preparation Products And Raw materials |
|