|
|
| | Thalidomide-NH-CH2-COOH Basic information |
| Product Name: | Thalidomide-NH-CH2-COOH | | Synonyms: | Glycine, N-[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]-;[(2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)amino]acetic acid;Thalidomide-NH-CH2-COOH;3-dioxoisoindol-4-yl]amino]acetic acid;3-dioxoisoindolin-4-yl)glycine;6-dioxopiperidin-3-yl)-1;(2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)glycine;inhibit,Ligands for E3 Ligase,E3 ligase-recruiting Moiety,Inhibitor,Thalidomide NH CH2 COOH,ThalidomideNHCH2COOH,cereblon,Thalidomide-NH-CH-2-COOH,CRBN,Thalidomide | | CAS: | 927670-97-1 | | MF: | C15H13N3O6 | | MW: | 331.28 | | EINECS: | | | Product Categories: | | | Mol File: | 927670-97-1.mol |  |
| | Thalidomide-NH-CH2-COOH Chemical Properties |
| Boiling point | 713.9±60.0 °C(Predicted) | | density | 1.637±0.06 g/cm3(Predicted) | | solubility | DMSO : 50 mg/mL (150.93 mM; Need ultrasonic) | | pka | 3.92±0.10(Predicted) | | InChI | InChI=1S/C15H13N3O6/c19-10-5-4-9(13(22)17-10)18-14(23)7-2-1-3-8(12(7)15(18)24)16-6-11(20)21/h1-3,9,16H,4-6H2,(H,20,21)(H,17,19,22) | | InChIKey | LRGLFYOYKPSPJQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)CNC1=CC=CC2=C1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| | Thalidomide-NH-CH2-COOH Usage And Synthesis |
| Definition |
Thalidomide-NH-CH2-COOH contains a thalidomide group, an amide, an alkylC2 chain, and a terminal carboxylic acid. This product is ready for conjugation to target proteins for PROTAC R&D. It is the Thalidomide-based cereblon ligand used in the recruitment of CRBN protein. This compound also can be connected to the ligand for protein by a linker to form PROTACs, such as THAL-SNS-032 (HY-123937).
|
| | Thalidomide-NH-CH2-COOH Preparation Products And Raw materials |
|