| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
| Products Intro: |
Product Name:2-methylthioadenosine
CAS:4105-39-9
Purity:98% Package:按需包装
|
|
| | 2-methylthioadenosine Basic information |
| Product Name: | 2-methylthioadenosine | | Synonyms: | 2-Methylthioadenosine ( 2-MeS-Ado );2-[6-AMINO-2-(METHYLSULFANYL)PURIN-9-YL]-5-(HYDROXYMETHYL)OXOLANE-3,4-DIOL;(2R,3R,4S,5R)-2-(6-Amino-2-(methylthio)-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol;2-Methylthioadenosine ADA inhibitor,platelet ADP receptor (made from GL101374);Adenosine, 2-(methylthio)-;Zeatin Impurity 1;Zeatin Impurity | | CAS: | 4105-39-9 | | MF: | C11H15N5O4S | | MW: | 313.33 | | EINECS: | | | Product Categories: | | | Mol File: | 4105-39-9.mol |  |
| | 2-methylthioadenosine Chemical Properties |
| Melting point | 225 °C | | Boiling point | 747.6±70.0 °C(Predicted) | | density | 1.98±0.1 g/cm3(Predicted) | | pka | 13.08±0.70(Predicted) | | InChI | InChI=1S/C11H15N5O4S/c1-21-11-14-8(12)5-9(15-11)16(3-13-5)10-7(19)6(18)4(2-17)20-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2,12,14,15)/t4-,6-,7-,10-/m1/s1 | | InChIKey | AJNDEAZTAFKOOO-KQYNXXCUSA-N | | SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=C(SC)N=3)N)N=C2)[C@H](O)[C@@H]1O |
| | 2-methylthioadenosine Usage And Synthesis |
| Chemical Properties | White to Off-white Crystalline Powder
| | Definition | 2-Methylthioadenosine is an adenosine precursor to 2-MeS-ATP, 2-MeS-ADP and 2-MeS-AMP. |
| | 2-methylthioadenosine Preparation Products And Raw materials |
|