|
|
| | 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide Basic information |
| Product Name: | 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide | | Synonyms: | 2, 4-diaMino-6-(broMoMethyl)-pteridine HCL;2,4-diamino-6-(bromomethyl)pteridine(for methotrexate);6-BROMOMETHYL-PTERIDINE-2,4-DIAMINE HBR;2,4-Diamino-6-(bromomethyl)pteridine Hydrobromide;2,4-PteridinediaMine, 6-(broMoMethyl)-, MonohydrobroMide;6-(BroMoMethyl)-2,4-pteridinediaMine HydrobroMide (Technical Grade);Nsc253943;6-Bromomethyl-pteridine-2,4-diamine hydrobromide | | CAS: | 52853-40-4 | | MF: | C7H8Br2N6 | | MW: | 335.99 | | EINECS: | 692-499-2 | | Product Categories: | Aromatics;Bases & Related Reagents;Inhibitors;Nucleotides;Aromatics Compounds | | Mol File: | 52853-40-4.mol |  |
| | 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide Chemical Properties |
| Melting point | >195°C (dec.) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Light Brown to Brown | | InChI | InChI=1S/C7H7BrN6.BrH/c8-1-3-2-11-6-4(12-3)5(9)13-7(10)14-6;/h2H,1H2,(H4,9,10,11,13,14);1H | | InChIKey | KMQIBGKVZDBGAH-UHFFFAOYSA-N | | SMILES | NC1=NC(N)=NC2=NC=C(CBr)N=C12.Br |
| | 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide Usage And Synthesis |
| Description | 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide is a potent inhibitor of the enzyme nitroaldolase (EC 1.2.1.22) and has been shown to inhibit cell growth in murine leukemia cells. This reaction is mediated by the addition of bromide to isobutyl esters, leading to a benzyl ester intermediate which undergoes an electrophilic attack on nitroaldolase. The mechanism of action for this drug involves the inhibition of membrane transport and chloride ion influx, which are necessary for the proliferation of tumor cells. 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide also inhibits DNA synthesis through its effects on thymidylate synthase, preventing nucleotide production from thymine and dihydrofolate reductase activity. | | Chemical Properties | Light Brown Solid | | Uses | 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide can be used as organic synthesis intermediate and pharmaceutical intermediate. | | Application | 6-(Bromomethyl)-2,4-pteridinediamine Hydrobromide (Technical Grade) is a useful research chemical used in the preparation of novel methotrexate derivatives as antirheumatic agents as well as the preparation of pteridine reductase inhibitors. |
| | 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide Preparation Products And Raw materials |
|