|
| 2-(Aminomethyl)-1-ethylpyrrolidine Basic information |
| 2-(Aminomethyl)-1-ethylpyrrolidine Chemical Properties |
Boiling point | 58-60 °C16 mm Hg(lit.) | density | 0.884 g/mL at 25 °C(lit.) | refractive index | n20/D 1.4670(lit.) | Fp | 135 °F | storage temp. | 2-8°C | solubility | Chloroform (Sparingly), Methanol (Sparingly) | pka | 10.04±0.40(Predicted) | form | Liquid | color | Clear yellow | InChI | InChI=1S/C7H16N2/c1-2-9-5-3-4-7(9)6-8/h7H,2-6,8H2,1H3 | InChIKey | UNRBEYYLYRXYCG-UHFFFAOYSA-N | SMILES | N1(CC)CCCC1CN | LogP | 0.433 (est) | CAS DataBase Reference | 26116-12-1(CAS DataBase Reference) | NIST Chemistry Reference | 2-Pyrrolidinemethanamine, 1-ethyl-(26116-12-1) |
Hazard Codes | Xi,Xn | Risk Statements | 36/37/38-20/21/22 | Safety Statements | 26-36 | RIDADR | UN 1993 3/PG 3 | WGK Germany | 3 | HazardClass | 3.2 | PackingGroup | III | HS Code | 29339900 |
| 2-(Aminomethyl)-1-ethylpyrrolidine Usage And Synthesis |
Chemical Properties | clear yellow liquid | Uses | 2-(Aminomethyl)-1-ethylpyrrolidine is used as a reagent in the synthesis of S-Desethyl S-Methyl Amisulpride (D289595) |
| 2-(Aminomethyl)-1-ethylpyrrolidine Preparation Products And Raw materials |
|