- 2-Methyl-2-adamantanol
-
- $0.00 / 1kg
-
2024-05-29
- CAS:702-98-7
- Min. Order: 1kg
- Purity: 99%+
- Supply Ability: 100000kg per Month
- 2-Methyl-2-adamantanol
-
- $18.00 / 10kg
-
2024-05-10
- CAS:702-98-7
- Min. Order: 1kg
- Purity: 99.9
- Supply Ability: 5000
- 2-Methyl-2-adamantanol
-
- $30.00 / 1kg
-
2024-04-24
- CAS:702-98-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 5000kg/week
|
| | 2-Methyl-2-adamantanol Basic information |
| | 2-Methyl-2-adamantanol Chemical Properties |
| Melting point | 214-218 °C | | Boiling point | 234.5°C (rough estimate) | | density | 0.8802 (rough estimate) | | refractive index | 1.5000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.99±0.20(Predicted) | | form | Crystalline Powder | | color | White | | Water Solubility | insoluble | | InChI | InChI=1S/C11H18O/c1-11(12)9-3-7-2-8(5-9)6-10(11)4-7/h7-10,12H,2-6H2,1H3 | | InChIKey | JKOZWMQUOWYZAB-UHFFFAOYSA-N | | SMILES | C12CC3CC(CC(C3)C1(C)O)C2 | | CAS DataBase Reference | 702-98-7(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Methyl-2-adamantanol(702-98-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29029090 |
| | 2-Methyl-2-adamantanol Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | 2-Methyl-2-adamantanol is a chemical used in various research applications for the preparation of photoresist compositions. |
| | 2-Methyl-2-adamantanol Preparation Products And Raw materials |
|