| Identification | Back Directory | [Name]
Aceclofenac Benzyl Ester | [CAS]
100499-89-6 | [Synonyms]
Aceclofenac-F Aceclofenac IMp. F (EP) Aceclofenac Benzyl Ester Aceclofenac EP IMpurity F Aceclofenac impurity F CRS Aceclofenac IMpurity-F(EP/BP) Benzyl [[[2-[(2,6-Dichlorophenyl)am Aceclofenac Impurity 6(Aceclofenac EP Impurity F) Aceclofenac EP Impurity F (Aceclofenac Benzyl Ester) Aceclofenac Benzyl Ester (Aceclofenac EP Impurity F) benzyl 2-(2-(2-(2,6-dichlorophenylaMino)phenyl)acetoxy)acetate Benzyl {{{2-[(2,6-dichlorophenyl)amino]phenyl}acetyl}oxy}acetate (2-oxo-2-phenylmethoxyethyl) 2-[2-(2,6-dichloroanilino)phenyl]acetate 2-Oxo-2-(phenylmethoxy)ethyl 2-[(2,6-dichlorophenyl)amino]benzeneacetate 2-[(2,6-Dichlorophenyl)aMino]benzeneacetic Acid 2-Oxo-2-(phenylMethoxy)ethyl Ester Benzeneacetic acid, 2-[(2,6-dichlorophenyl)amino]-, 2-oxo-2-(phenylmethoxy)ethyl ester Aceclofenac EP Impurity FQ: What is
Aceclofenac EP Impurity F Q: What is the CAS Number of
Aceclofenac EP Impurity F Q: What is the storage condition of
Aceclofenac EP Impurity F Q: What are the applications of
Aceclofenac EP Impurity F | [Molecular Formula]
C23H19Cl2NO4 | [MDL Number]
MFCD17170095 | [MOL File]
100499-89-6.mol | [Molecular Weight]
444.31 |
| Chemical Properties | Back Directory | [Boiling point ]
539.3±50.0 °C(Predicted) | [density ]
1.348±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [solubility ]
Chloroform (Slightly), Methanol (Slightly) | [form ]
neat | [pka]
-2.85±0.50(Predicted) | [Major Application]
pharmaceutical (small molecule) | [InChI]
1S/C23H19Cl2NO4/c24-18-10-6-11-19(25)23(18)26-20-12-5-4-9-17(20)13-21(27)30-15-22(28)29-14-16-7-2-1-3-8-16/h1-12,26H,13-15H2 | [InChIKey]
RLKZSYGBKCIRFJ-UHFFFAOYSA-N | [SMILES]
Clc1c(c(ccc1)Cl)Nc2c(cccc2)CC(=O)OCC(=O)OCc3ccccc3 |
|
| Company Name: |
OPULENT PHARMA
|
| Tel: |
+91-9106692785 |
| Website: |
www.www.NOWEBSITE |
|