| Identification | Back Directory | [Name]
Diacetic Aceclofenac | [CAS]
1216495-92-9 | [Synonyms]
Diacetic Aceclofenac Aceclofenac IMp. H (EP) Aceclofenac impurity H CRS Aceclofenac IMpurity H(EP/BP) Aceclofenac Impurity EP H (Diacetic Aceclofenac) {{{{{{{2-[(2,6-Dichlorophenyl)amino]phenyl}acetyl}oxy}acetyl}oxy}acetyl}oxy}acetic acid 2-[(2,6-Dichlorophenyl)aMino]benzeneacetic Acid 2-[2-(CarboxyMethoxy)-2-oxoethoxy]-2-oxoethyl Ester | [Molecular Formula]
C20H17Cl2NO8 | [MDL Number]
MFCD17170096 | [MOL File]
1216495-92-9.mol | [Molecular Weight]
470.26 |
| Chemical Properties | Back Directory | [Melting point ]
118 - 121°C | [Boiling point ]
617.0±55.0 °C(Predicted) | [density ]
1.486±0.06 g/cm3(Predicted) | [storage temp. ]
Hygroscopic, -20°C Freezer, Under inert atmosphere | [solubility ]
DMSO (Slightly), Ethyl Acetate (Slightly) | [form ]
neat | [pka]
2.46±0.10(Predicted) | [color ]
White to Off-White | [Major Application]
pharmaceutical (small molecule) | [InChI]
1S/C20H17Cl2NO8/c21-13-5-3-6-14(22)20(13)23-15-7-2-1-4-12(15)8-17(26)30-10-19(28)31-11-18(27)29-9-16(24)25/h1-7,23H,8-11H2,(H,24,25) | [InChIKey]
ZCCRLKICIDWHKV-UHFFFAOYSA-N | [SMILES]
Clc1c(c(ccc1)Cl)Nc2c(cccc2)CC(=O)OCC(=O)OCC(=O)OCC(=O)O |
| Hazard Information | Back Directory | [Uses]
A 2-[(2,6-dichlorophenyl)amino]phenylacetoxyacetyl derivative as anti-inflammmatory and analgesic agent. | [Uses]
A 2-[(2,6-dichlorophenyl)amino]phenylacetoxyacetyl derivative as anti-inflammmatory and analgesic agent. (Aceclofenac EP Impurity H) |
|
| Company Name: |
OPULENT PHARMA
|
| Tel: |
+91-9106692785 |
| Website: |
www.www.NOWEBSITE |
| Company Name: |
TOSUN PHARM
|
| Tel: |
61855200 13326451905 |
| Website: |
www.toref.cn/ |
|