| Identification | More |  [Name]
  1-(4-Nitrophenyl)methyl-1,2,4-triazole |  [CAS]
  119192-09-5 |  [Synonyms]
  1-(4-NITROBENZYL)-1,2,4-TRIAZOLE 1-(4-NITROBENZYL)-1H-[1,2,4]TRIAZOLE 1-(4-NITROPHENYL)METHYL-1,2,4-TRIAZOLE 1-[(4-NITROPHENYL)METHYL]-1H-1,2,4-TRIAZOLE 1H-1-[(4-Aminophenyl)methyl][1,2,4]triazole 1H-1,2,4-Triazole,1-[(4-nitrophenyl)methyl]- |  [Molecular Formula]
  C9H8N4O2 |  [MDL Number]
  MFCD03840588 |  [Molecular Weight]
  204.19 |  [MOL File]
  119192-09-5.mol |  
 | Chemical Properties | Back Directory |  [Melting point ]
  100.0 to 104.0 °C |  [Boiling point ]
  433.4±47.0 °C(Predicted) |  [density ]
  1.39±0.1 g/cm3(Predicted) |  [storage temp. ]
  Sealed in dry,Room Temperature |  [solubility ]
  Acetonitrile (Slightly), Chloroform (Slightly) |  [form ]
  Solid |  [pka]
  2.46±0.10(Predicted) |  [color ]
  Light Yellow to Yellow |  [InChI]
  InChI=1S/C9H8N4O2/c14-13(15)9-3-1-8(2-4-9)5-12-7-10-6-11-12/h1-4,6-7H,5H2 |  [InChIKey]
  NVRYCUYVBBCXHT-UHFFFAOYSA-N |  [SMILES]
  N1(CC2=CC=C([N+]([O-])=O)C=C2)C=NC=N1 |  [CAS DataBase Reference]
  119192-09-5(CAS DataBase Reference) |  
  
             | 
            
            
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                    
                        
                            | Company Name: | 
                            
                                Roshel Laboratories  
                             | 
                         
                        
                            | Tel: | 
                            +91-8310388232 +91-9964951765 | 
                         
                        
                        
                            | Website: | 
                            www.roshellaboratories.com | 
                         
                    
                 
                
                
                
                
                
                
                
                
                
                
                
                
                
                
                    
                        
                            | Company Name: | 
                            
                                China Langchem Inc.  
                             | 
                         
                        
                            | Tel: | 
                            0086-21-58956006  | 
                         
                        
                        
                            | Website: | 
                            www.chemicalbook.com/ShowSupplierProductsList19141/0_EN.htm | 
                         
                    
                 
                
             |