| Identification | Back Directory | [Name]
5-methoxy-2-(2H-1,2,3-triazol-2-yl)benzoic acid | [CAS]
1293284-55-5 | [Synonyms]
5-methoxy-2-(2H-1,2,3-triazol-2-yl)benzoic acid | [EINECS(EC#)]
826-805-4 | [Molecular Formula]
C10H9N3O3 | [MOL File]
1293284-55-5.mol | [Molecular Weight]
219.197 |
| Questions And Answer | Back Directory | [Uses]
5-Methoxy-2-(2H-1,2,3-triazol-2-yl)benzoic acid is commonly used as an intermediate in organic synthesis and pharmaceutical chemistry. It can be used as a core structure for drug molecules to modify and synthesize compounds with specific biological activities. In the pharmaceutical field, it is frequently used to prepare the drug molecule suvorexin, the first marketed orexin receptor antagonist, which promotes sleep by increasing drowsiness and improving sleep quality. |
| Chemical Properties | Back Directory | [InChI]
InChI=1S/C10H9N3O3/c1-16-7-2-3-9(8(6-7)10(14)15)13-11-4-5-12-13/h2-6H,1H3,(H,14,15) | [InChIKey]
OFURCFFCWJMVKQ-UHFFFAOYSA-N | [SMILES]
C(O)(=O)C1=CC(OC)=CC=C1N1N=CC=N1 |
|
|