| Identification | Back Directory | [Name]
triisopropylsilyl Methacrylate | [CAS]
134652-60-1 | [Synonyms]
TISMA triisopropylsilyl Methacrylate Triisopropylsilyl Methacrylate (TISMA) tri(propan-2-yl)silyl 2-methylprop-2-enoate 2-Methyl-2-propenoic acid tris(1-methylethyl)silyl ester 2-Propenoic acid, 2-methyl-, tris(1-methylethyl)silyl ester | [EINECS(EC#)]
700-182-8 | [Molecular Formula]
C13H26O2Si | [MDL Number]
MFCD28978458 | [MOL File]
134652-60-1.mol | [Molecular Weight]
242.43 |
| Chemical Properties | Back Directory | [Boiling point ]
249.6±9.0 °C(Predicted) | [density ]
0.870±0.06 g/cm3(Predicted) | [vapor pressure ]
3.9-5.1hPa at 20-25℃ | [InChI]
InChI=1S/C13H26O2Si/c1-9(2)13(14)15-16(10(3)4,11(5)6)12(7)8/h10-12H,1H2,2-8H3 | [InChIKey]
KNNOZYMZRGTZQM-UHFFFAOYSA-N | [SMILES]
C(O[Si](C(C)C)(C(C)C)C(C)C)(=O)C(C)=C | [LogP]
6.5 |
|
|