| Identification | Back Directory | [Name]
D-GALACTURONIC ACID | [CAS]
14984-39-5 | [Synonyms]
D-(+)-Galacturonic sodium salt D-Galacturonic acid,monosodium salt (9CI) D-Galacturonic acid sodium salt >=95.0% (T) D-Galacturonic acid sodiuM salt >=98.0% (T) (4S)-3,4,5,6-tetrahydroxyoxane-2-carboxylate | [Molecular Formula]
C6H9Na1O7 | [MDL Number]
MFCD06201013 | [MOL File]
14984-39-5.mol | [Molecular Weight]
216.12 |
| Chemical Properties | Back Directory | [form ]
Powder | [color ]
White to Off-white | [biological source]
plant | [Optical Rotation]
[α]/D +36.5±2°, 5 hr, c = 10% in H2O | [Sensitive ]
Hygroscopic | [InChI]
1S/C6H10O7.Na/c7-1-2(8)4(5(10)11)13-6(12)3(1)9;/h1-4,6-9,12H,(H,10,11);/q;+1/p-1/t1-,2+,3+,4-,6?;/m0./s1 | [InChIKey]
MSXHSNHNTORCAW-KSSASCOMSA-M | [SMILES]
[Na+].OC1O[C@@H]([C@H](O)[C@H](O)[C@H]1O)C([O-])=O |
| Hazard Information | Back Directory | [Uses]
D-(+)-Galacturonic acid sodium salt is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
|