| Identification | Back Directory | [Name]
Methanesulfonato{[4-(N,N-Dimethylamino)Phenyl]Di-T-Butylphosphino}(2'-Amino-1,1'-Biphenyl-2-Yl)Palladium(II) | [CAS]
1820817-64-8 | [Synonyms]
Amphos Palladacycle Gen. 3
Methanesulfonato{[4-(N,N-dimethylamino)phenyl]di-t-butylphosphino}(2'-amino-1,1'-biphenyl-2-yl)palladium(II)
Methanesulfonato{[4-(N,N-dimethylamino)phenyl]di-t-butylphosphino}(2'-amino-1,1'-biphenyl-2-yl)palladium(II),[Amphos Palladacycle Gen. 3]
METHANESULFONATO{[4-(N,N-DIMETHYLAMINO)PHENYL]DI-T-BUTYLPHOSPHINO}(2'-AMINO-1,1'-BIPHENYL-2-YL)PALLADIUM(II),MIN.98%[AMPHOSPALLADACYCLEGEN.3] | [Molecular Formula]
C29H41N2O3PPdS | [MDL Number]
MFCD27978423 | [MOL File]
1820817-64-8.mol | [Molecular Weight]
635.11 |
| Chemical Properties | Back Directory | [Melting point ]
192-201 °C (decomposition) | [storage temp. ]
Inert atmosphere,2-8°C | [form ]
Powder | [color ]
beige to tan | [InChIKey]
FIUVWUZOSNWJIP-UHFFFAOYSA-N | [SMILES]
P(C1C=CC(N(C)C)=CC=1)([Pd+2]1(NC2=CC=CC=C2C2=CC=CC=[C-]12)[O-]S(=O)(=O)C)(C(C)(C)C)C(C)(C)C |
| Hazard Information | Back Directory | [Uses]
APhos Pd G3 is a Buchwald precatalyst that can be used in cross-coupling reactions. | [reaction suitability]
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Cross Couplings
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst |
|
|