| Identification | Back Directory | [Name]
1,3,5-Triazine,2-chloro-4-(1-dibenzofuranyl)-6-phenyl- | [CAS]
1883265-32-4 | [Synonyms]
2-Chloro-4-(1-dibenzofuranyl)-6-phenyl-1,3,5-triazine 1,3,5-Triazine,2-chloro-4-(1-dibenzofuranyl)-6-phenyl- 2-Chloro-4-(dibenzofuran-1-yl)-6-phenyl-[1,3,5]triazine 2-chloro-4-(dibenzo[b,d]furan-1-yl)-6-phenyl-1,3,5-triazine | [Molecular Formula]
C21H12ClN3O | [MDL Number]
MFCD32709292 | [MOL File]
1883265-32-4.mol | [Molecular Weight]
357.79 |
| Chemical Properties | Back Directory | [Boiling point ]
613.2±47.0 °C(Predicted) | [density ]
1.362±0.06 g/cm3(Predicted) | [pka]
-0.40±0.10(Predicted) | [InChI]
InChI=1S/C21H12ClN3O/c22-21-24-19(13-7-2-1-3-8-13)23-20(25-21)15-10-6-12-17-18(15)14-9-4-5-11-16(14)26-17/h1-12H | [InChIKey]
PJJAZVKQILCJTF-UHFFFAOYSA-N | [SMILES]
N1=C(C2=CC=CC=C2)N=C(C2=C3C4=CC=CC=C4OC3=CC=C2)N=C1Cl |
| Hazard Information | Back Directory | [Uses]
Used as an intermediate in the organic synthesis. | [Synthesis]
2-Chloro-4-(1-dibenzofuranyl)-6-phenyl-1,3,5-triazineine is synthesized by reacting B-1-Dibenzofuranylboronic acid with 2,4-Dichloro-6-phenyl-1,3,5-triazine rufluxed in THF for overnight catalystsed by Tetrabutylammonium bromide.
 |
|
| Company Name: |
Sholon Chem-Tech Co.,Ltd Gold
|
| Telephone: |
+86-19901505185 +86-15312550623 |
| Website: |
https://www.trusyn.com.cn |
| Company Name: |
Shanghai Uchem Inc.
|
| Telephone: |
15618758386 15618758386 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList15300/0_EN.htm |
| Company Name: |
Sunshine Optoelectronic
|
| Telephone: |
027-027-87915283 15972929998 |
| Website: |
http://www.sunshine-oled.com |
| Company Name: |
Baynoe Chem Co.,LTD
|
| Telephone: |
+86-021-34783353 15000719740 |
| Website: |
http://www.baynoe.com |
|