| Identification | Back Directory | [Name]
Methyl 3-butynoate | [CAS]
32804-66-3 | [Synonyms]
Methyl but-3-ynoate
Methyl 2-Methylbut-3-ynoate | [Molecular Formula]
C5H6O2 | [MDL Number]
MFCD02262210 | [MOL File]
32804-66-3.mol | [Molecular Weight]
98.1 |
| Chemical Properties | Back Directory | [Boiling point ]
59-61 °C(Press: 50 Torr) | [density ]
0.997±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [InChI]
InChI=1S/C5H6O2/c1-3-4-5(6)7-2/h1H,4H2,2H3 | [InChIKey]
JGEGAAGXXWDCOJ-UHFFFAOYSA-N | [SMILES]
C(OC)(=O)CC#C |
| Hazard Information | Back Directory | [Uses]
Methyl But-3-ynoate is used in preparation of phenylalanine derivatives as non-peptide GLP-1 receptor agonists and sensitizers. |
|
| Company Name: |
Struchem Co., Ltd. Gold
|
| Telephone: |
0512-63009836 18994340901 |
| Website: |
http://www.beidapharma.com |
| Company Name: |
parabiochem
|
| Telephone: |
025-83453382-8005 |
| Website: |
www.parabiochem.cn |
| Company Name: |
Cool Pharm, Ltd
|
| Telephone: |
021-58581007 18019463053 |
| Website: |
http://www.coolpharm.com.cn |
| Company Name: |
Labnetwork lnc.
|
| Telephone: |
+86-27-50766799 +86-18062016861 |
| Website: |
www.labnetwork.com |
| Company Name: |
GL Biochem (Shanghai) Ltd.
|
| Telephone: |
+86-021-61263370 +86-18901917034 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList212835/0_EN.htm |
| Company Name: |
AFINE CHEMICALS LIMITED
|
| Telephone: |
+86-571-85134551 +86-18958018566 |
| Website: |
www.afinechem.com/index.html |
|