| Identification | Back Directory | [Name]
P,P′-(9,9-Dimethyl-9H-xanthene-4,5-diyl)bis[N,N,N′,N′-tetraethyl-phosphonous diamide] 97% | [CAS]
349100-75-0 | [Synonyms]
XANTPHOS BASED LIGAND 97% XantPhos based ligand -tetraethyl-phosphonous diamide] 1,1’-(9,9-dimethyl-9H-xanthene-4,5-diyl)bis(N,N,N’,N’-tetraethylphosphanediamine) Phosphonous diamide, P,P'-(9,9-dimethyl-9H-xanthene-4,5-diyl)bis[N,N,N',N'-tetraethyl- P,P′-(9,9-Dimethyl-9H-xanthene-4,5-diyl)bis[N,N,N′,N′-tetraethyl-phosphonous diamide] 97% | [Molecular Formula]
C31H52N4OP2 | [MDL Number]
MFCD13182459 | [MOL File]
349100-75-0.mol | [Molecular Weight]
558.72 |
| Chemical Properties | Back Directory | [Melting point ]
99-104°C | [Boiling point ]
627.9±55.0 °C(Predicted) | [storage temp. ]
-20°C, stored under nitrogen | [form ]
solid | [pka]
7.20±0.40(Predicted) | [Appearance]
White to off-white Solid | [InChI]
InChI=1S/C31H52N4OP2/c1-11-32(12-2)37(33(13-3)14-4)27-23-19-21-25-29(27)36-30-26(31(25,9)10)22-20-24-28(30)38(34(15-5)16-6)35(17-7)18-8/h19-24H,11-18H2,1-10H3 | [InChIKey]
APRIDPKHBSWSHQ-UHFFFAOYSA-N | [SMILES]
C1(C)(C)C2=C(C(P(N(CC)CC)N(CC)CC)=CC=C2)OC2=C1C=CC=C2P(N(CC)CC)N(CC)CC |
| Hazard Information | Back Directory | [Uses]
A ligand used in coupling reactions such as Buchwald and Suzuki, and is a metal chelate ligand that can be used in catalytic reactions. | [reaction suitability]
reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Telephone: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
| Company Name: |
chemmole
|
| Telephone: |
400-168-9330 15013243073 |
| Website: |
http://www.chemmolemall.com/ |
|