| Identification | More | [Name]
N-(4-Chloro-3-nitrophenyl)acetamide | [CAS]
5540-60-3 | [Synonyms]
3NC 3-NITRO-4-CHLOROACETANILIDE 4-CHLORO-3-NITROPHENYLACETAMIDE A-(4-CHLORO-3-NITROPHENYL)ACETAMIDE M-NITRO-P-CHLORO ACETANILIDE n-(4-chloro-3-nitrophenyl)acetamide TIMTEC-BB SBB007993 2-(4-Chloro-3-nitrophenyl)acetamide Acetamide, N-(4-chloro-3-nitrophenyl)- alpha-(4-Chloro-3-nitrophenyl)acetamide 4-chloro-3-nitroacetanilide 4-CHLORO-3-NITROPHENYLACETAMIDE 95% | [EINECS(EC#)]
226-904-7 | [Molecular Formula]
C8H7ClN2O3 | [MDL Number]
MFCD00017143 | [Molecular Weight]
214.61 | [MOL File]
5540-60-3.mol |
|
|