| Identification | More | [Name]
9-METHYL-3,4-DIHYDRO-2H-PYRIDO[1,2-A]PYRIMIDIN-2-ONE | [CAS]
61751-44-8 | [Synonyms]
3,4-DIHYDRO-9-METHYL-2H-PYRIDO[1,2-ALPHA]PYRIMIDIN-2-ONE 9-METHYL-3,4-DIHYDRO-2H-PYRIDO[1,2-A]PYRIMIDIN-2-ONE ACID CAPTOR 9M 3,4-Dihydro-9-methyl-2H-pyrido[1,2-$a]pyrimidin-2-one 3,4-Dihydro-9-methyl-2H-pyrido[1,2-α]pyrimidin-2-one | [Molecular Formula]
C9H12N2O | [MDL Number]
MFCD00059749 | [Molecular Weight]
164.2 | [MOL File]
61751-44-8.mol |
| Chemical Properties | Back Directory | [Melting point ]
226 °C | [Boiling point ]
279.6±23.0 °C(Predicted) | [density ]
1.22±0.1 g/cm3(Predicted) | [form ]
powder to crystal | [pka]
3.09±0.20(Predicted) | [color ]
White to Almost white | [InChI]
InChI=1S/C9H10N2O/c1-7-3-2-5-11-6-4-8(12)10-9(7)11/h2-3,5H,4,6H2,1H3 | [InChIKey]
HPVULYKIYNGGJG-UHFFFAOYSA-N | [SMILES]
C12C(C)=CC=CN1CCC(=O)N=2 | [CAS DataBase Reference]
61751-44-8(CAS DataBase Reference) |
|
| Company Name: |
Energy Chemical
|
| Tel: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Maya High Purity Chemicals
|
| Tel: |
+86 (573) 82222445 (0)18006601000 452520369 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15221/0_EN.htm |
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
|