| Identification | Back Directory | [Name]
3,5-Dimethyl-1-adamantanol | [CAS]
707-37-9 | [Synonyms]
ST5202979 NSC 102294 AKOS BC-0635 AG-690/09406022 Memantine USP RC B Memantine Impurity 2 1,3-DiMethyl-5-adaMantanol 3,5-DIMETHYL-1-ADAMANTANOL MeMantine Related CoMpound B (3,5-Dimethyladamantane-1-ol) 3,5-Dimethyl-1-adamantanol> Memantine USP Related Compound B 3,5-DiMethyl-1-hydroxyadaMantane 1-Hydroxy-3,5-dimethyladamantane 1,3-Dimethyl-5-hydroxyadamantane Memantine Impurity 2(Memantine USP RC B) (1r,3R,5S,7r)-3,5-dimethyladamantan-1-ol 3,5-DiMethyltricyclo[3.3.1.13,7]decan-1-ol Memantine Related Compund B (3,5-Dimethyladamantane-1-ol) Memantine Related Compound B (15 mg) (3,5-Dimethyladamantane-1-ol) Memantine HCl USP Related Compound B (1-Hydroxy-3,5-dimethyladamantane) Memantine related compound BQ: What is
Memantine related compound B Q: What is the CAS Number of
Memantine related compound B Q: What is the storage condition of
Memantine related compound B Q: What are the applications of
Memantine related compound B | [EINECS(EC#)]
615-150-8 | [Molecular Formula]
C12H20O | [MDL Number]
MFCD00074775 | [MOL File]
707-37-9.mol | [Molecular Weight]
180.29 |
| Chemical Properties | Back Directory | [Melting point ]
95 °C | [Boiling point ]
247.2±8.0 °C(Predicted) | [density ]
1.121±0.06 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,Room Temperature | [solubility ]
Chloroform (Slightly), Methanol (Slightly) | [form ]
Solid | [pka]
15.41±0.60(Predicted) | [color ]
White to Off-White | [InChI]
InChI=1S/C12H20O/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9,13H,3-8H2,1-2H3 | [InChIKey]
LBWCITVBZLTEKW-UHFFFAOYSA-N | [SMILES]
C12(O)CC3(C)CC(CC(C)(C3)C1)C2 |
|
|