| Identification | More | [Name]
4-Nitrobenzyl 2-diazoacetoacetate | [CAS]
82551-63-1 | [Synonyms]
p-Nitrobenzyl 2-diazoacetoacetate
p-Nitrobenzyl-diazoacetoacetate
4-Nitrobenzyl 2-diazoacetoacetate | [EINECS(EC#)]
1806241-263-5 | [Molecular Formula]
C11H9N3O5 | [MDL Number]
MFCD11977231 | [Molecular Weight]
263.21 | [MOL File]
82551-63-1.mol |
| Chemical Properties | Back Directory | [solubility ]
DMSO (Slightly), Methanol (Slightly) | [form ]
Solid | [color ]
Pale Yellow to Light Yellow | [InChI]
InChI=1S/C11H9N3O5/c1-7(15)10(13-12)11(16)19-6-8-2-4-9(5-3-8)14(17)18/h2-5H,6H2,1H3 | [InChIKey]
HEKGSEIAAGMGPL-UHFFFAOYSA-N | [SMILES]
C(=[N+]=[N-])(C(=O)C)C(=O)OCC1C=CC(N(=O)=O)=CC=1 | [CAS DataBase Reference]
82551-63-1(CAS DataBase Reference) |
| Hazard Information | Back Directory | [Chemical Properties]
1KG; 25KG | [Synthesis]
The invention presents a method for preparing p-nitrobenzyl 2-diazoacetoacetate through a two-step reaction process. This method offers numerous benefits, such as streamlined processing steps, easier industrial production, reduced production costs, enhanced product quality, and increased yield. Using nitrobenzyl alcohol as a standard, the overall mol yield achieves 95% or more, and the purity of the product compound (IV) reaches at least 99.5%.
CN101983958A/en |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Adamas Reagent, Ltd.
|
| Telephone: |
4006009262 13023226327 |
| Website: |
http://www.tansoole.com |
| Company Name: |
T&W GROUP
|
| Telephone: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
Candia Thamtech Company Limited
|
| Telephone: |
0371-86615086 18203638366 0371-86159066 13526786601 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15771/0_EN.htm |
|