| Identification | Back Directory | [Name]
5-(1-Carboxyethyl)-2-(phenylthio)phenylacetic acid | [CAS]
83237-49-4 | [Synonyms]
5-(α-carboxyethyl)-2-phenylthio phenylacetic acid
5-(1-carboxylethyl)-2-phenylthiobenzeneacetic acid
2-[3-acetyloxy-4-(phenylthio)phenyl]propanoic acid
5-(A-CARBOXY ETHYL)-2-PHENYL THIOPHENYL ACETICACID
5-(1-Carboxyethyl)-2-(phenylthio)phenylacetic acid
1,3-Benzenediacetic acid, α1-methyl-4-(phenylthio)-
5-(alpha-Carboxyethyl)-2-Phenylthio-Phenylacetic Acid
5-(-carboxyethyl)-2-phenylthio-phenylacetic acid (intermediate of zaltoprofen) | [EINECS(EC#)]
1312995-182-4 | [Molecular Formula]
C17H16O4S | [MDL Number]
MFCD09952329 | [MOL File]
83237-49-4.mol | [Molecular Weight]
316.37 |
| Chemical Properties | Back Directory | [Melting point ]
145-146 °C(Solv: 1,2-dichloroethane (107-06-2)) | [Boiling point ]
517.4±50.0 °C(Predicted) | [density ]
1.34±0.1 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,2-8°C | [solubility ]
Acetone (Slightly), DMSO (Slightly) | [form ]
Solid | [pka]
4.09±0.10(Predicted) | [color ]
Off-White | [InChI]
InChI=1S/C17H16O4S/c1-11(17(20)21)12-7-8-15(13(9-12)10-16(18)19)22-14-5-3-2-4-6-14/h2-9,11H,10H2,1H3,(H,18,19)(H,20,21) | [InChIKey]
HCKQCCUGCHJSOS-UHFFFAOYSA-N | [SMILES]
C(C1C=C(C(C)C(=O)O)C=CC=1SC1C=CC=CC=1)C(=O)O |
| Hazard Information | Back Directory | [Chemical Properties]
White powder | [Uses]
2-(3-(Carboxymethyl)-4-(phenylthio)-phenyl)propanoic Acid is an intermediate used to prepare Zaltoprofen (Z146000) which is anti-inflammatory. |
|
| Company Name: |
yxinchem Gold
|
| Telephone: |
+86-0710-4323688 +86-18071785587 |
| Website: |
http://www.yxinchem.com |
| Company Name: |
Aemon Chemical
|
| Telephone: |
0086-755-86198205 |
| Website: |
www.aemonchem.com |
| Company Name: |
Sinfachem Limited.
|
| Telephone: |
025-84683399 13952017251 |
| Website: |
http://www.sinfachem.com |
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Telephone: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
|