| Identification | Back Directory | [Name]
7-DIETHYLAMINO-3-PHENYLCOUMARIN | [CAS]
84865-19-0 | [Synonyms]
S0806 7-DIETHYLAMINO-3-PHENYLCOUMARIN 3-Phenyl-7-(diethylamino)coumarin 7-DIETHYLAMINO-3-PHENYL-CHROMEN-2-ONE 7-(Diethylamino)-3-phenyl-2H-chromen-2-one 7-(Diethylamino)-3-phenyl-2H-1-benzopyran-2-one 3-Phenyl-7-(diethylamino)-2H-1-benzopyran-2-one 2H-1-Benzopyran-2-one, 7-(diethylamino)-3-phenyl- | [Molecular Formula]
C19H19NO2 | [MDL Number]
MFCD00408422 | [MOL File]
84865-19-0.mol | [Molecular Weight]
293.36 |
| Chemical Properties | Back Directory | [Melting point ]
151.0 to 155.0 °C | [storage temp. ]
2-8°C, protect from light | [form ]
powder to crystal | [color ]
Light yellow to Yellow to Green | [λmax]
397nm(CH3CN)(lit.) | [InChI]
InChI=1S/C19H19NO2/c1-3-20(4-2)16-11-10-15-12-17(14-8-6-5-7-9-14)19(21)22-18(15)13-16/h5-13H,3-4H2,1-2H3 | [InChIKey]
PSJYODMHCCQXQB-UHFFFAOYSA-N | [SMILES]
C1(=O)OC2=CC(N(CC)CC)=CC=C2C=C1C1=CC=CC=C1 |
|
| Company Name: |
TCI Chemicals
|
| Telephone: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
| Company Name: |
Finetech Industry Limited
|
| Telephone: |
+86-27-8746-5837 +86-18627785180 |
| Website: |
https://www.finetechnology-ind.com/ |
| Company Name: |
sgtlifesciences pvt ltd
|
| Telephone: |
+91-8790379245 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList1846349/0.htm |
| Company Name: |
Shaanxi Dideu Medichem Co. Ltd
|
| Telephone: |
+86-29-81139210 17389186172 |
| Website: |
https://www.chemicalbook.com/manufacturer/shaanxi-dideu-medichem-219/ |
| Company Name: |
Henan yingchuang
|
| Telephone: |
16650708709 |
| Website: |
www.hnyingchuang.com/ |
|