| Identification | More | [Name]
N-Chloroethyl-N-ethylaniline | [CAS]
92-49-9 | [Synonyms]
N-CHLOROETHYL-N-ETHYLANILINE N-ETHYL-N-CHLOROETHYL ANILINE 2-(n-ethylanilino)ethylchloride 4-chloro-n,n-diethyl-anilin emery5770 ethyl(chloroethyl)aniline n-(2-chloroethyl)-n-ethyl-anilin n-(2-chloroethyl)-n-ethyl-benzenamin n-(2-chloroethyl)-n-ethylbenzenamine n-ethyl-n-(2-chloroethyl)aniline N-[2-Chloroethyl]-N-ethylbenzeneamine N-Chlorethyl-N-ethylanilin N-(2-Chloroethyl)-N-ethylaniline | [EINECS(EC#)]
202-159-3 | [Molecular Formula]
C10H14ClN | [MDL Number]
MFCD00000966 | [Molecular Weight]
183.68 | [MOL File]
92-49-9.mol |
| Chemical Properties | Back Directory | [Melting point ]
46°C | [Boiling point ]
302.39°C (rough estimate) | [density ]
1.0821 (rough estimate) | [refractive index ]
1.6100 (estimate) | [pka]
5.52±0.50(Predicted) | [InChI]
InChI=1S/C10H14ClN/c1-2-12(9-8-11)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 | [InChIKey]
DBDNQNARCHWMSP-UHFFFAOYSA-N | [SMILES]
C1(N(CCCl)CC)=CC=CC=C1 | [CAS DataBase Reference]
92-49-9(CAS DataBase Reference) | [EPA Substance Registry System]
92-49-9(EPA Substance) |
|
|