2-Chloro-4-(2-furyl)pyrimidine
|
|
|
- CAS-Nr.
- 124959-28-0
- Englisch Name:
- 2-Chloro-4-(2-furyl)pyrimidine
- Synonyma:
- 2-Chloro-4-fur-2-ylpyrimidine;2-Chloro-4-(2-furyl)pyrimidine;2-(2-Chloropyrimidin-4-yl)furan;2-Chloro-4-fur-2-ylpyrimidine 97%;2-Chloro-4-(fur-2-yl)pyrimidine97%;Pyrimidine, 2-chloro-4-(2-furanyl)-
- CBNumber:
- CB1852992
- Summenformel:
- C8H5ClN2O
- Molgewicht:
- 180.59
- MOL-Datei:
- 124959-28-0.mol
|
2-Chloro-4-(2-furyl)pyrimidine Eigenschaften
- Schmelzpunkt:
- 81.5 °C
- Aggregatzustand
- solid
- Farbe
- Light brown
- InChI
- InChI=1S/C8H5ClN2O/c9-8-10-4-3-6(11-8)7-2-1-5-12-7/h1-5H
- InChIKey
- BLFCXYJTVFTNRX-UHFFFAOYSA-N
- SMILES
- C1(Cl)=NC=CC(C2=CC=CO2)=N1
- CAS Datenbank
- 124959-28-0
Sicherheit
- Risiko- und Sicherheitserklärung
- Gefahreninformationscode (GHS)
| R-Sätze: |
36 |
|
|
| S-Sätze: |
26 |
|
|
| Hazard Note |
Harmful |
|
|
| HS Code |
2933599590 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitsschädlich bei Verschlucken. |
Akute Toxizität oral |
Kategorie 4 |
Warnung |
|
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizität (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
|
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter spülen. |
|
2-Chloro-4-(2-furyl)pyrimidine Chemische Eigenschaften,Einsatz,Produktion Methoden
Synthesis Reference(s)
Journal of Heterocyclic Chemistry, 27, p. 1393, 1990
DOI: 10.1002/jhet.5570270539
2-Chloro-4-(2-furyl)pyrimidine Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2-Chloro-4-(2-furyl)pyrimidine Anbieter Lieferant Produzent Hersteller Vertrieb Händler.
Global( 35)Lieferanten
- 2-Chloro-4-(2-furyl)pyrimidine
- 2-Chloro-4-fur-2-ylpyrimidine
- 2-Chloro-4-fur-2-ylpyrimidine 97%
- 2-(2-Chloropyrimidin-4-yl)furan
- 2-Chloro-4-(fur-2-yl)pyrimidine97%
- Pyrimidine, 2-chloro-4-(2-furanyl)-
- 124959-28-0
