4-bromo-3-fluoro-1-methyl-1H-pyrazole
|
|
|
- CAS-Nr.
- 1785074-93-2
- Englisch Name:
- 4-bromo-3-fluoro-1-methyl-1H-pyrazole
- Synonyma:
- 4-bromo-3-fluoro-1-methylpyrazole;4-bromo-3-fluoro-1-methyl-1H-pyrazole;1H-Pyrazole, 4-bromo-3-fluoro-1-methyl-;4-bromo-3-fluoro-1-methyl-1H-pyrazole - [B59911]
- CBNumber:
- CB33340010
- Summenformel:
- C4H4BrFN2
- Molgewicht:
- 178.99
- MOL-Datei:
- 1785074-93-2.mol
|
4-bromo-3-fluoro-1-methyl-1H-pyrazole Eigenschaften
- Siedepunkt:
- 197.0±20.0 °C(Predicted)
- Dichte
- 1.82±0.1 g/cm3(Predicted)
- storage temp.
- Storage temp. 2-8°C
- pka
- -2.20±0.10(Predicted)
- Aussehen
- Colorless to light yellow Solid-Liquid Mixture
- InChI
- InChI=1S/C4H4BrFN2/c1-8-2-3(5)4(6)7-8/h2H,1H3
- InChIKey
- ZZVJLGMTZXVPQV-UHFFFAOYSA-N
- SMILES
- N1(C)C=C(Br)C(F)=N1
Sicherheit
- Risiko- und Sicherheitserklärung
- Gefahreninformationscode (GHS)
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitsschädlich bei Verschlucken. |
Akute Toxizität oral |
Kategorie 4 |
Warnung |
|
P264, P270, P301+P312, P330, P501 |
| H312 |
Gesundheitsschädlich bei Hautkontakt. |
Akute Toxizität dermal |
Kategorie 4 |
Warnung |
|
P280,P302+P352, P312, P322, P363,P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
| H332 |
Gesundheitsschädlich bei Einatmen. |
Akute Toxizität inhalativ |
Kategorie 4 |
Warnung |
|
P261, P271, P304+P340, P312 |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizität (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
|
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter spülen. |
|
4-bromo-3-fluoro-1-methyl-1H-pyrazole Chemische Eigenschaften,Einsatz,Produktion Methoden
4-bromo-3-fluoro-1-methyl-1H-pyrazole Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
4-bromo-3-fluoro-1-methyl-1H-pyrazole Anbieter Lieferant Produzent Hersteller Vertrieb Händler.
Global( 45)Lieferanten
- 4-bromo-3-fluoro-1-methyl-1H-pyrazole
- 1H-Pyrazole, 4-bromo-3-fluoro-1-methyl-
- 4-bromo-3-fluoro-1-methylpyrazole
- 4-bromo-3-fluoro-1-methyl-1H-pyrazole - [B59911]
- 1785074-93-2
