4,4'-dibroMo-2,2'-dinitrobiphenyl
|
|
|
- CAS-Nr.
- 91371-12-9
- Englisch Name:
- 4,4'-dibroMo-2,2'-dinitrobiphenyl
- Synonyma:
- 4,4'-Dibrom-2,2'-dinitro-biphenyl;4,4'-dibroMo-2,2'-dinitrobiphenyl;4,4'-Dibromo-2,2'-dinitro-1,1'-biphenyl;1,1'-Biphenyl, 4,4'-dibroMo-2,2'-dinitro-;4-bromo-1-(4-bromo-2-nitrophenyl)-2-nitrobenzene
- CBNumber:
- CB42657248
- Summenformel:
- C12H6Br2N2O4
- Molgewicht:
- 401.99
- MOL-Datei:
- 91371-12-9.mol
|
4,4'-dibroMo-2,2'-dinitrobiphenyl Eigenschaften
- Schmelzpunkt:
- 145-150°C
- Siedepunkt:
- 452.9±40.0 °C(Predicted)
- Dichte
- 1.907±0.06 g/cm3(Predicted)
- storage temp.
- Sealed in dry,Room Temperature
- Aggregatzustand
- solid
- Aussehen
- Light yellow to yellow Solid
- InChI
- 1S/C12H6Br2N2O4/c13-7-1-3-9(11(5-7)15(17)18)10-4-2-8(14)6-12(10)16(19)20/h1-6H
- InChIKey
- REUCYFQYHWKXPH-UHFFFAOYSA-N
- SMILES
- [O-][N+](=O)c1cc(Br)ccc1-c2ccc(Br)cc2[N+]([O-])=O
Sicherheit
- Risiko- und Sicherheitserklärung
- Gefahreninformationscode (GHS)
| Kennzeichnung gefährlicher |
Xi,N |
|
|
| R-Sätze: |
37/38-41-50 |
|
|
| S-Sätze: |
26-39-61 |
|
|
| RIDADR |
UN 3077 9 / PGIII |
|
|
| WGK Germany |
3 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Hazard Classifications |
Aquatic Acute 1 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
|
|
| Bildanzeige (GHS) |
 
|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H318 |
Verursacht schwere Augenschäden. |
Schwere Augenschädigung |
Kategorie 1 |
Achtung |
 |
P280, P305+P351+P338, P310 |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizität (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
| H400 |
Sehr giftig für Wasserorganismen. |
Kurzfristig (akut) gewässergefährdend |
Kategorie 1 |
Warnung |
 |
P273, P391, P501 |
|
| Sicherheit |
| P273 |
Freisetzung in die Umwelt vermeiden. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P302+P352 |
BEI BERÜHRUNG MIT DER HAUT: Mit viel Wasser/... (Hersteller kann, falls zweckmäßig, ein Reinigungsmittel angeben oder, wenn Wasser eindeutig ungeeignet ist, ein alternatives Mittel empfehlen) waschen. |
|
4,4'-dibroMo-2,2'-dinitrobiphenyl Chemische Eigenschaften,Einsatz,Produktion Methoden
4,4'-dibroMo-2,2'-dinitrobiphenyl Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
4,4'-dibroMo-2,2'-dinitrobiphenyl Anbieter Lieferant Produzent Hersteller Vertrieb Händler.
Global( 62)Lieferanten
- 4,4'-dibroMo-2,2'-dinitrobiphenyl
- 1,1'-Biphenyl, 4,4'-dibroMo-2,2'-dinitro-
- 4-bromo-1-(4-bromo-2-nitrophenyl)-2-nitrobenzene
- 4,4'-Dibrom-2,2'-dinitro-biphenyl
- 4,4'-Dibromo-2,2'-dinitro-1,1'-biphenyl
- 91371-12-9
- C12H6Br2N2O4