2R-ephedrone hydrochloride
|
|
|
- CAS-Nr.
- 152610-69-0
- Englisch Name:
- 2R-ephedrone hydrochloride
- Synonyma:
- R(+)-Methcathinone HCl;2R-ephedrone hydrochloride;R(+)-METHCATHINONE HYDROCHLORIDE;R(+)-Methcathinone hydrochloride solution;(2R)-2-(methylamino)-1-phenylpropan-1-one:hydrochloride;Methanol (test R(+)-MethcathinoneHCl,1.0mg/mLasfreebase)
- CBNumber:
- CB5201303
- Summenformel:
- C10H14ClNO
- Molgewicht:
- 199.68
- MOL-Datei:
- 152610-69-0.mol
|
2R-ephedrone hydrochloride Eigenschaften
- Flammpunkt:
- 9℃
- storage temp.
- -20°C
- Aggregatzustand
- liquid
- Major Application
- forensics and toxicology
- InChI
- 1S/C10H13NO.ClH/c1-8(11-2)10(12)9-6-4-3-5-7-9;/h3-8,11H,1-2H3;1H/t8-;/m1./s1
- InChIKey
- LTJXNCHDKYZOSY-DDWIOCJRSA-N
- SMILES
- Cl.CN[C@H](C)C(=O)c1ccccc1
Sicherheit
- Risiko- und Sicherheitserklärung
- Gefahreninformationscode (GHS)
| Kennzeichnung gefährlicher |
F,T |
|
|
| R-Sätze: |
11-23/24/25-39/23/24/25 |
|
|
| S-Sätze: |
7-16-36/37-45 |
|
|
| RIDADR |
UN1230 - class 3 - PG 2 - Methanol, solution |
|
|
| WGK Germany |
1 |
|
|
| Speicherklasse |
3 - Flammable liquids |
|
|
| Hazard Classifications |
Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
|
|
| Bildanzeige (GHS) |
 
|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H225 |
Flüssigkeit und Dampf leicht entzündbar. |
Entzündbare Flüssigkeiten |
Kategorie 2 |
Achtung |
 |
P210,P233, P240, P241, P242, P243,P280, P303+ P361+P353, P370+P378,P403+P235, P501 |
| H370 |
Schädigt die Organe. |
Spezifische Zielorgan-Toxizität (einmalige Exposition) |
Kategorie 1 |
Achtung |
 |
P260, P264, P270, P307+P311, P321,P405, P501 |
|
| Sicherheit |
| P210 |
Von Hitze, heißen Oberflächen, Funken, offenen Flammen und anderen Zündquellenarten fernhalten. Nicht rauchen. |
| P260 |
Dampf/Aerosol/Nebel nicht einatmen. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P301+P310 |
BEI VERSCHLUCKEN: Sofort GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
| P311 |
GIFTINFORMATIONSZENTRUM/Arzt anrufen. |
|
2R-ephedrone hydrochloride Chemische Eigenschaften,Einsatz,Produktion Methoden
2R-ephedrone hydrochloride Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2R-ephedrone hydrochloride Anbieter Lieferant Produzent Hersteller Vertrieb Händler.
Global( 0)Lieferanten
| Firmenname |
Telefon |
E-Mail |
Land |
Produktkatalog |
Edge Rate |
- R(+)-METHCATHINONE HYDROCHLORIDE
- R(+)-Methcathinone HCl
- R(+)-Methcathinone hydrochloride solution
- (2R)-2-(methylamino)-1-phenylpropan-1-one:hydrochloride
- Methanol (test R(+)-MethcathinoneHCl,1.0mg/mLasfreebase)
- 2R-ephedrone hydrochloride
- 152610-69-0