3-Chloro-4-(trifluoromethyl)benzonitrile
|
|
|
- CAS-Nr.
- 1092460-79-1
- Englisch Name:
- 3-Chloro-4-(trifluoromethyl)benzonitrile
- Synonyma:
- 2-Chloro-4-cyanotrifluoromethylbenzene;3-Chloro-4-(trifluoromethyl)benzonitrile;Benzonitrile, 3-chloro-4-(trifluoromethyl)-
- CBNumber:
- CB6669476
- Summenformel:
- C8H3ClF3N
- Molgewicht:
- 205.56
- MOL-Datei:
- Mol file
|
3-Chloro-4-(trifluoromethyl)benzonitrile Eigenschaften
- Schmelzpunkt:
- 38-40°
- Siedepunkt:
- 226.5±40.0 °C(Predicted)
- Dichte
- 1.43±0.1 g/cm3(Predicted)
- storage temp.
- Sealed in dry,Room Temperature
- Aussehen
- White to off-white Solid
- InChI
- InChI=1S/C8H3ClF3N/c9-7-3-5(4-13)1-2-6(7)8(10,11)12/h1-3H
- InChIKey
- IWZFPSVQIDJRAD-UHFFFAOYSA-N
- SMILES
- C(#N)C1=CC=C(C(F)(F)F)C(Cl)=C1
Sicherheit
- Risiko- und Sicherheitserklärung
- Gefahreninformationscode (GHS)
| RIDADR |
UN3439 |
|
|
| HazardClass |
6.1 |
|
|
| HS Code |
2926907090 |
|
|
| Bildanzeige (GHS) |

|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H311 |
Giftig bei Hautkontakt. |
Akute Toxizität dermal |
Kategorie 3 |
Achtung |
 |
P280, P302+P352, P312, P322, P361,P363, P405, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
|
| Sicherheit |
| P260 |
Dampf/Aerosol/Nebel nicht einatmen. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P312 |
Bei Unwohlsein GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
|
3-Chloro-4-(trifluoromethyl)benzonitrile Chemische Eigenschaften,Einsatz,Produktion Methoden
3-Chloro-4-(trifluoromethyl)benzonitrile Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
3-Chloro-4-(trifluoromethyl)benzonitrile Anbieter Lieferant Produzent Hersteller Vertrieb Händler.
Global( 73)Lieferanten
- Benzonitrile, 3-chloro-4-(trifluoromethyl)-
- 2-Chloro-4-cyanotrifluoromethylbenzene
- 3-Chloro-4-(trifluoromethyl)benzonitrile
- 1092460-79-1