(4-Fluoro-3,5-dimethylphenyl)hydrazine hydrochloride
|
|
|
- CAS-Nr.
- 2212021-40-2
- Englisch Name:
- (4-Fluoro-3,5-dimethylphenyl)hydrazine hydrochloride
- Synonyma:
- 4-Fluoro-3,5-dimethylphenylhydrazine HCL;Fluoro-3,5-dimethylphenyl)hydrazine hydrochloride;4-fluoro-3,5-dimethylbenzenehydrazinehydrochloride;(4-Fluoro-3,5-dimethylphenyl)hydrazine hydrochloride;4-fluorine-3,5-Dimethylphenylhydrazine hydrochloride;(4-Fluoro-3,5-dimethylphenyl)hydrazine hydrochloride - [F89839]
- CBNumber:
- CB69045756
- Summenformel:
- C8H12ClFN2
- Molgewicht:
- 190.65
- MOL-Datei:
- 2212021-40-2.mol
|
(4-Fluoro-3,5-dimethylphenyl)hydrazine hydrochloride Eigenschaften
- InChI
- InChI=1S/C8H11FN2.ClH/c1-5-3-7(11-10)4-6(2)8(5)9;/h3-4,11H,10H2,1-2H3;1H
- InChIKey
- OPXRKRXGKCMCPJ-UHFFFAOYSA-N
- SMILES
- N(C1C=C(C)C(F)=C(C)C=1)N.Cl
Sicherheit
- Risiko- und Sicherheitserklärung
- Gefahreninformationscode (GHS)
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitsschädlich bei Verschlucken. |
Akute Toxizität oral |
Kategorie 4 |
Warnung |
 |
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizität (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter spülen. |
|
(4-Fluoro-3,5-dimethylphenyl)hydrazine hydrochloride Chemische Eigenschaften,Einsatz,Produktion Methoden
Beschreibung
(4-Fluoro-3,5-dimethylphenyl)hydrazine hydrochloride is an organic compound containing a fluorobenzene ring and a hydrazine functional group. It usually exists as a white solid hydrochloride salt with the molecular formula C₈H₁₂ClFN₂ and a molecular weight of 190.65. As an aromatic hydrazine derivative, it exhibits high reactivity in organic synthesis, primarily due to its hydrazine group, making it an important precursor for constructing complex heterocyclic compounds, especially pyrazole ring systems.
(4-Fluoro-3,5-dimethylphenyl)hydrazine hydrochloride Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
(4-Fluoro-3,5-dimethylphenyl)hydrazine hydrochloride Anbieter Lieferant Produzent Hersteller Vertrieb Händler.
Global( 149)Lieferanten
- (4-Fluoro-3,5-dimethylphenyl)hydrazine hydrochloride
- (4-Fluoro-3,5-dimethylphenyl)hydrazine hydrochloride - [F89839]
- 4-fluorine-3,5-Dimethylphenylhydrazine hydrochloride
- 4-fluoro-3,5-dimethylbenzenehydrazinehydrochloride
- Fluoro-3,5-dimethylphenyl)hydrazine hydrochloride
- 4-Fluoro-3,5-dimethylphenylhydrazine HCL
- 2212021-40-2
- 1