Boronic acid, B,B'-[(1,2-diphenyl-1,2-ethenediyl)di-4,1-phenylene]bis-
4,4'-(1,2-Diphenyl-1,2-ethenylene)diphenylboronic acid
|
|
|
- CAS-Nr.
- 1054451-31-8
- Englisch Name:
- Boronic acid, B,B'-[(1,2-diphenyl-1,2-ethenediyl)di-4,1-phenylene]bis-
4,4'-(1,2-Diphenyl-1,2-ethenylene)diphenylboronic acid
- Synonyma:
- TPE-BA;[(1,2-Diphenylethene-1,2-diyl)bis(4,1-phenylene)]diboronic acid;4,4'-(1,2-diphenylethene-1,2-diyl)bis(1,4-phenylene)diboronic acid;4,4'-(1,2-diphenylethene-1,2-diyl)bis(4,1-phenylene)diboronic acid;(1,2-diphenylethene-1,2-diyl)bis(4,4'-phenylene)-1,1'-diboronic acid;Boronic acid, B,B'-[(1,2-diphenyl-1,2-ethenediyl)di-4,1-phenylene]bis-;Boronic acid, B,B'-[(1,2-diphenyl-1,2-ethenediyl)di-4,1-phenylene]bis-
4,4'-(1,2-Diphenyl-1,2-ethenylene)diphenylboronic acid
- CBNumber:
- CB72664751
- Summenformel:
- C26H22B2O4
- Molgewicht:
- 420.07
- MOL-Datei:
- 1054451-31-8.mol
|
Boronic acid, B,B'-[(1,2-diphenyl-1,2-ethenediyl)di-4,1-phenylene]bis-
4,4'-(1,2-Diphenyl-1,2-ethenylene)diphenylboronic acid Eigenschaften
- storage temp.
- 2-8°C
- Aggregatzustand
- solid
- InChI
- 1S/C26H22B2O4/c29-27(30)23-15-11-21(12-16-23)25(19-7-3-1-4-8-19)26(20-9-5-2-6-10-20)22-13-17-24(18-14-22)28(31)32/h1-18,29-32H/b26-25+
- InChIKey
- CFKHFTZRFSABDV-OCEACIFDSA-N
- SMILES
- OB(O)C(C=C1)=CC=C1/C(C2=CC=CC=C2)=C(C3=CC=C(B(O)O)C=C3)\C4=CC=CC=C4
Sicherheit
- Risiko- und Sicherheitserklärung
- Gefahreninformationscode (GHS)
| WGK Germany |
WGK 3 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitsschädlich bei Verschlucken. |
Akute Toxizität oral |
Kategorie 4 |
Warnung |
 |
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizität (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P301+P312 |
BEI VERSCHLUCKEN: Bei Unwohlsein GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
| P302+P352 |
BEI BERÜHRUNG MIT DER HAUT: Mit viel Wasser/... (Hersteller kann, falls zweckmäßig, ein Reinigungsmittel angeben oder, wenn Wasser eindeutig ungeeignet ist, ein alternatives Mittel empfehlen) waschen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter spülen. |
|
Boronic acid, B,B'-[(1,2-diphenyl-1,2-ethenediyl)di-4,1-phenylene]bis-
4,4'-(1,2-Diphenyl-1,2-ethenylene)diphenylboronic acid Chemische Eigenschaften,Einsatz,Produktion Methoden
Verwenden
TPE-BA is an aggregation-induced emission (AIE) dye for use in Suzuki reaction and D-Glucose detection.
Allgemeine Beschreibung
Aggregation-induced emission luminogens (AIEgens) such as tetraphenylethene (TPE) functionalized with boronic acids form luminogen (TPE-BA). TPE-BA can form oligoboronates with D-glucose. Other sugars also form monoadduct with TPE-BA, but once such a complex is formed there is no more cis-diol that allows the oligomerization reaction to proceed, resulting in a very low emission intensity. Thus, TPE-BA could serve as a glucose-specific probe.
Boronic acid, B,B'-[(1,2-diphenyl-1,2-ethenediyl)di-4,1-phenylene]bis-
4,4'-(1,2-Diphenyl-1,2-ethenylene)diphenylboronic acid Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
Boronic acid, B,B'-[(1,2-diphenyl-1,2-ethenediyl)di-4,1-phenylene]bis-
4,4'-(1,2-Diphenyl-1,2-ethenylene)diphenylboronic acid Anbieter Lieferant Produzent Hersteller Vertrieb Händler.
Global( 24)Lieferanten
- 4,4'-(1,2-diphenylethene-1,2-diyl)bis(4,1-phenylene)diboronic acid
- [(1,2-Diphenylethene-1,2-diyl)bis(4,1-phenylene)]diboronic acid
- Boronic acid, B,B'-[(1,2-diphenyl-1,2-ethenediyl)di-4,1-phenylene]bis-
4,4'-(1,2-Diphenyl-1,2-ethenylene)diphenylboronic acid
- (1,2-diphenylethene-1,2-diyl)bis(4,4'-phenylene)-1,1'-diboronic acid
- Boronic acid, B,B'-[(1,2-diphenyl-1,2-ethenediyl)di-4,1-phenylene]bis-
- TPE-BA
- 4,4'-(1,2-diphenylethene-1,2-diyl)bis(1,4-phenylene)diboronic acid
- 1054451-31-8