| Company Name: |
|
| Tel: |
|
| Email: |
carrie@kelongchem.com |
| Products Intro: |
Cas:32492-61-8
ProductName:Ethoxylated Bisphenol A
|
| Company Name: |
HUNEI MEIBEI NEW MATERIAL Co., Ltd.
|
| Tel: |
18271819653 |
| Email: |
1483755123@qq.com |
| Products Intro: |
Cas:32492-61-8
ProductName:Ethoxylated Bisphenol A
Purity: 99% HPLC | Package: 1KG;5KG;25KG
|
| Company Name: |
Rhawn Reagent
|
| Tel: |
400-400-1332688 18019345275 |
| Email: |
huyue@rhawn.cn |
| Products Intro: |
Cas:32492-61-8
ProductName:Ethoxylated Bisphenol A
|
Bisphenol A Ethoxylate manufacturers
|
| | Bisphenol A Ethoxylate Basic information |
| | Bisphenol A Ethoxylate Chemical Properties |
| Boiling point | 350℃[at 101 325 Pa] | | density | 1.18 g/mL at 25 °C | | vapor pressure | 0Pa at 25℃ | | refractive index | n20/D 1.552 | | Fp | >230 °F | | form | viscous liquid | | Water Solubility | 697mg/L at 20℃ | | InChI | 1S/C15H16O2.C2H6O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;3-1-2-4/h3-10,16-17H,1-2H3;3-4H,1-2H2 | | InChIKey | PFZPRMFEGRUXTO-UHFFFAOYSA-N | | SMILES | OCCO.CC(C)(c1ccc(O)cc1)c2ccc(O)cc2 | | LogP | 2.77 at 30℃ | | EPA Substance Registry System | Polyethylene glycol, diether with bisphenol A (2:1) (32492-61-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-36/37-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Bisphenol A Ethoxylate Usage And Synthesis |
| Physical properties | Bisphenol A Ethoxylate is a viscous liquid. | | Color |
light yellow
| | Health Hazard | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| | Bisphenol A Ethoxylate Preparation Products And Raw materials |
|