|
|
| | Bis(3,4-epoxycyclohexylmethyl) adipate Basic information |
| Product Name: | Bis(3,4-epoxycyclohexylmethyl) adipate | | Synonyms: | hexanedioicacid,bis(7-oxabicyclo(4.1.0)hept-3-ylmethylester;Hexanedioicacid,bis(7-oxabicyclo[4.1.0]hept-3-ylmethyl)ester;Bis((3,4-epoxycyclohexyl)methyl)adipat;Adipic acid bis(3,4-epoxycyclohexane-1-ylmethyl) ester;Adipic acid bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) ester;Adipic acid bis[(7-oxabicyclo[4.1.0]heptane-3-yl)methyl] ester;Hexanedioic acid bis(7-oxabicyclo[4.1.0]heptane-3-ylmethyl) ester;Hexanedioic acid bis[(7-oxabicyclo[4.1.0]heptan-3-yl)methyl] ester | | CAS: | 3130-19-6 | | MF: | C20H30O6 | | MW: | 366.45 | | EINECS: | 221-518-5 | | Product Categories: | Plasticizers;Polymer Additives;Polymer Science | | Mol File: | 3130-19-6.mol |  |
| | Bis(3,4-epoxycyclohexylmethyl) adipate Chemical Properties |
| Boiling point | 457.21°C (rough estimate) | | density | 1.149 g/mL at 25 °C(lit.) | | vapor pressure | 0Pa at 25℃ | | refractive index | n20/D 1.493(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | Appearance | Colorless to light yellow Liquid | | Water Solubility | 2mg/L at 20℃ | | InChI | InChI=1S/C20H30O6/c21-19(23-11-13-5-7-15-17(9-13)25-15)3-1-2-4-20(22)24-12-14-6-8-16-18(10-14)26-16/h13-18H,1-12H2 | | InChIKey | DJUWPHRCMMMSCV-UHFFFAOYSA-N | | SMILES | C(OCC1CCC2C(O2)C1)(=O)CCCCC(OCC1CCC2C(O2)C1)=O | | LogP | 2.98 at 20℃ | | EPA Substance Registry System | Hexanedioic acid, bis(7-oxabicyclo[4.1.0]hept-3-ylmethyl) ester (3130-19-6) |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | MO1880550 | | TSCA | TSCA listed |
| | Bis(3,4-epoxycyclohexylmethyl) adipate Usage And Synthesis |
| Uses | Used as Intermediates of epoxy resins, coating of food packaging materials and intermediates of electronic materials. | | Flammability and Explosibility | Not classified |
| | Bis(3,4-epoxycyclohexylmethyl) adipate Preparation Products And Raw materials |
|