| Company Name: |
Shanghai Haohong Pharmaceutical Co., Ltd.
|
| Tel: |
400-8210725 400821072 |
| Email: |
malulu@leyan.com |
| Products Intro: |
Cas:150206-05-6
ProductName:5-Carboxyfluorescein diacetate N-succinimidyl ester
Purity: 98%
|
| Company Name: |
Shenzhen GeneSeqTools Bioscience & Technology Co. Ltd.
|
| Tel: |
0755-23251735 13302967066 |
| Email: |
sales@geneseqtools.com |
| Products Intro: |
Cas:150206-05-6
ProductName:5-Carboxy-fluorescein diacetate N-succinimidyl ester
Purity: 98% HPLC | Package: 1mg;5mg;100mg;定制包装
|
| Company Name: |
Santa Cruz Biotechnology Inc
|
| Tel: |
021-60936350 |
| Email: |
scbt@scbt.com |
| Products Intro: |
Cas:150206-05-6
ProductName:5-Carboxy-fluorescein diacetate N-succinimidyl ester
|
| Company Name: |
SHANGHAI ZZBIO CO., LTD.
|
| Tel: |
18019219489 18901678489 |
| Email: |
tech@zzbioco.com |
| Products Intro: |
Cas:150206-05-6
ProductName:5-Carboxyfluorescein diacetate N-Hydroxysuccinimide Ester
Purity: >=97% | Package: 50mg
|
|
| | Carboxyfluorescein Diacetate Basic information |
| Product Name: | Carboxyfluorescein Diacetate | | Synonyms: | 5-Carboxyfluorescein diacetate succinimidyl ester;5-CARBOXY-DI-O-ACETYLFLUORESCEIN;5-CARBOXY-DI-O-ACETYLFLUORESCEIN N-SUCCINIMIDYL ESTER;5(6)-(N-SUCCINIMIDYLOXYCARBONYL)-3',6',O,O'-DIACETYLFLUORESCEIN;5(6)-CARBOXYFLUORESCEIN DIACETATE-N-HYDROXY-SUCCINIMIDE ESTER;5(6)-CARBOXYFLUORESCEIN DIACETATE N-SUCCINIMIDYL ESTER;5-(AND-6)-CARBOXY SNAFL(R)-1, DIACETATE;5-(AND-6)-CARBOXY SNAFL(R)-2, DIACETATE | | CAS: | 150206-05-6 | | MF: | C29H19NO11 | | MW: | 557.46 | | EINECS: | | | Product Categories: | | | Mol File: | 150206-05-6.mol |  |
| | Carboxyfluorescein Diacetate Chemical Properties |
| Melting point | 152-154 °C(lit.) | | Boiling point | 757.9±70.0 °C(Predicted) | | density | 1.60±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO: soluble | | form | Solid | | color | White to off-white | | InChIKey | SRSXVRUMXPCNAJ-UHFFFAOYSA-N | | SMILES | C12(C3=C(C=C(OC(C)=O)C=C3)OC3=C1C=CC(OC(C)=O)=C3)C1=C(C=C(C(ON3C(=O)CCC3=O)=O)C=C1)C(=O)O2 |
| | Carboxyfluorescein Diacetate Usage And Synthesis |
| Description | 5-Carboxyfluorescein diacetate succinimidyl ester is a cell-permeable probe that is used as a tracer for long-term cell labeling. | | Uses | 5-CFDA N-succinimidyl ester is membrane-permeant and can be loaded into cells via incubation. Once inside the cells, 5-CFDA is hydrolyzed by intracellular esterases to 5-carboxyfluorescein. It has been used for labeling human intervertebral disk cells in vitro for fluorescen | | Uses | 5-Carboxy-fluorescein Diacetate N-Succinimidyl Ester is a fluorescein tracer for cell labeling. It was used as a reactant in the bioorthogonal imaging of Aurora Kinase A in live cells. | | Excitation / Emission Maximum | 553 nm/575 nm |
| | Carboxyfluorescein Diacetate Preparation Products And Raw materials |
|