|
|
| | 6-Carboxyfluorescein 3’,6’-Diacetate N-Succinimidyl Ester Basic information |
| | 6-Carboxyfluorescein 3’,6’-Diacetate N-Succinimidyl Ester Chemical Properties |
| storage temp. | −20°C | | solubility | DMF: soluble | | InChIKey | JGPOSNWWINVNFV-UHFFFAOYSA-N | | SMILES | CC(=O)Oc1ccc2c(Oc3cc(OC(C)=O)ccc3C24OC(=O)c5ccc(cc45)C(=O)ON6C(=O)CCC6=O)c1 |
| WGK Germany | 3 | | F | 10-21 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | 6-Carboxyfluorescein 3’,6’-Diacetate N-Succinimidyl Ester Usage And Synthesis |
| Chemical Properties | Light yellow powder | | Uses | 6-Carboxyfluorescein 3’,6’-Diacetate N-Succinimidyl Ester is a 6-Carboxyfluorescein (C178225) derivative used to monitor lymphocyte proliferation by covalently labelling long-lived intracellular molecules with fluorescent dye. | | Uses | 6-Carboxyfluorescein 3’,6’-Diacetate N-Succinimidyl Ester is a 6-Carboxyfluorescein (C178225) derivative used to monitor lymphocyte proliferation by covalently labelling long-lived intracellular molecules with fluorescent dye. |
| | 6-Carboxyfluorescein 3’,6’-Diacetate N-Succinimidyl Ester Preparation Products And Raw materials |
|