|
|
| | 1-(4-Chlorophenyl)-2-Cyclopropylpropanon-1 Basic information |
| Product Name: | 1-(4-Chlorophenyl)-2-Cyclopropylpropanon-1 | | Synonyms: | 1-(4-Chlorophenyl)-2-Cyclopropylpropanon-1;1-Propanone, 1-(4-chlorophenyl)-2-cyclopropyl-;1-(4-Chlorophenyl)-2-cyclopropylpropan-1-one;1-(4-chlorophenyl)-2-cyclopropyl-1-propanone;1- (4-chlorophenyl) -2-cyclopropyl-1-acetone;Intermediate of cyclohexanol (PPT) | | CAS: | 123989-29-7 | | MF: | C12H13ClO | | MW: | 208.68 | | EINECS: | 602-964-3 | | Product Categories: | | | Mol File: | 123989-29-7.mol |  |
| | 1-(4-Chlorophenyl)-2-Cyclopropylpropanon-1 Chemical Properties |
| Boiling point | 310.3±15.0 °C(Predicted) | | density | 1.180 | | vapor pressure | 0.22-0.35Pa at 20-25℃ | | storage temp. | 2-8°C | | InChI | InChI=1S/C12H13ClO/c1-8(9-2-3-9)12(14)10-4-6-11(13)7-5-10/h4-9H,2-3H2,1H3 | | InChIKey | LRWCURGZPQWMRG-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(Cl)C=C1)(=O)C(C1CC1)C | | LogP | 3.9 at 25℃ and pH8.5 | | Surface tension | 62.9mN/m at 3.15mg/L and 20℃ |
| | 1-(4-Chlorophenyl)-2-Cyclopropylpropanon-1 Usage And Synthesis |
| Uses | 1-(4-Chlorophenyl)-2-cyclopropylpropan-1-one is used in process for preparation of epoxides from aldehydes or ketones with sulfonium salts. |
| | 1-(4-Chlorophenyl)-2-Cyclopropylpropanon-1 Preparation Products And Raw materials |
|