|
|
| | 2-(4-CHLORO-3,5-DIMETHYL-PHENOXY)-PROPIONIC ACID Basic information |
| Product Name: | 2-(4-CHLORO-3,5-DIMETHYL-PHENOXY)-PROPIONIC ACID | | Synonyms: | 2-(4-chloro-3,5-dimethylphenoxy)propanoic acid;2-(4-chloro-3,5-dimethylphenoxy)propanoic acid(SALTDATA: FREE);ART-CHEM-BB B013863;CHEMBRDG-BB 3013863;2-(4-CHLORO-3,5-DIMETHYL-PHENOXY)-PROPIONIC ACID;AKOS B013863;ASINEX-REAG BAS 13522242;TIMTEC-BB SBB004561 | | CAS: | 14234-20-9 | | MF: | C11H13ClO3 | | MW: | 228.67 | | EINECS: | | | Product Categories: | | | Mol File: | 14234-20-9.mol |  |
| | 2-(4-CHLORO-3,5-DIMETHYL-PHENOXY)-PROPIONIC ACID Chemical Properties |
| Melting point | 137-138 °C | | Boiling point | 358.0±37.0 °C(Predicted) | | density | 1.229±0.06 g/cm3(Predicted) | | pka | 3.16±0.10(Predicted) | | form | solid | | InChI | 1S/C11H13ClO3/c1-6-4-9(5-7(2)10(6)12)15-8(3)11(13)14/h4-5,8H,1-3H3,(H,13,14) | | InChIKey | OGSDXLUKTYSYNE-UHFFFAOYSA-N | | SMILES | CC(Oc1cc(C)c(Cl)c(C)c1)C(O)=O |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-(4-CHLORO-3,5-DIMETHYL-PHENOXY)-PROPIONIC ACID Usage And Synthesis |
| | 2-(4-CHLORO-3,5-DIMETHYL-PHENOXY)-PROPIONIC ACID Preparation Products And Raw materials |
|