| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | Morpholine, 4-(3-azetidinyl)- (9CI) Basic information |
| | Morpholine, 4-(3-azetidinyl)- (9CI) Chemical Properties |
| Boiling point | 227℃ | | density | 1.100 | | Fp | 91℃ | | InChI | InChI=1S/C7H14N2O/c1-3-10-4-2-9(1)7-5-8-6-7/h7-8H,1-6H2 | | InChIKey | GLHXYSFEVOAOSL-UHFFFAOYSA-N | | SMILES | N1(C2CNC2)CCOCC1 | | CAS DataBase Reference | 302355-79-9 |
| | Morpholine, 4-(3-azetidinyl)- (9CI) Usage And Synthesis |
| Uses | 4-(Azetidin-3-yl)morpholine may be useful in the preparation of quinoxaline derivatives as AXL and c Met kinase inhibitors. |
| | Morpholine, 4-(3-azetidinyl)- (9CI) Preparation Products And Raw materials |
|