2-amino-3,5-Dicyanoacetophenone manufacturers
|
| | 2-amino-3,5-Dicyanoacetophenone Basic information |
| Product Name: | 2-amino-3,5-Dicyanoacetophenone | | Synonyms: | 2-amino-3,5-Dicyanoacetophenone;2-AMINO-3,5-DICYANO-4-METHYL THIOPHENE ( 2-ADCMT);5-amino-3-methylthiophene-2,4-dicarbonitrile;2,4-Thiophenedicarbonitrile, 5-amino-3-methyl- | | CAS: | 52603-48-2 | | MF: | C7H5N3S | | MW: | 163.2 | | EINECS: | 610-868-8 | | Product Categories: | | | Mol File: | 52603-48-2.mol |  |
| | 2-amino-3,5-Dicyanoacetophenone Chemical Properties |
| Melting point | 215℃ | | density | 1.36 | | vapor pressure | 0Pa at 25℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Powder | | InChI | InChI=1S/C7H5N3S/c1-4-5(2-8)7(10)11-6(4)3-9/h10H2,1H3 | | InChIKey | GCSCENSWKWQJQG-UHFFFAOYSA-N | | SMILES | C1(C#N)SC(N)=C(C#N)C=1C | | LogP | 1.84 | | Surface tension | 60.16mN/m at 98.1mg/L and 23.8℃ |
| | 2-amino-3,5-Dicyanoacetophenone Usage And Synthesis |
| | 2-amino-3,5-Dicyanoacetophenone Preparation Products And Raw materials |
|