| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
cis-8-Tetradecen-1-olacetate manufacturers
|
| | cis-8-Tetradecen-1-olacetate Basic information |
| | cis-8-Tetradecen-1-olacetate Chemical Properties |
| Boiling point | 333.5±21.0℃ (760 Torr) | | density | 0.878±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | 98.5±20.4℃ | | InChI | InChI=1S/C16H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h7-8H,3-6,9-15H2,1-2H3/b8-7- | | InChIKey | VZGHIFSDFDWSOD-FPLPWBNLSA-N | | SMILES | C(OC(=O)C)CCCCCC/C=C\CCCCC | | LogP | 6.566 (est) |
| | cis-8-Tetradecen-1-olacetate Usage And Synthesis |
| Uses | (Z)-8-Tetradecenyl Acetate is a component of sex pheromone in the greenheaded leafroller moth. | | Definition | ChEBI: 8Z-Tetradecenyl acetate is a carboxylic ester. |
| | cis-8-Tetradecen-1-olacetate Preparation Products And Raw materials |
|