|
|
| | 2,3,4-Pentanetrione, 3-oxime (6CI,7CI,8CI,9CI) Basic information |
| Product Name: | 2,3,4-Pentanetrione, 3-oxime (6CI,7CI,8CI,9CI) | | Synonyms: | 2,3,4-Pentanetrione, 3-oxime (6CI,7CI,8CI,9CI);2,3,4-Pentanetrione, 3-oxime;pentane-2,3,4-trione 3-oxime;3-Hydroxyimino-2,4-pentanedione;3-Isonitroso-2,4-pentanedione;Isonitrosoacetylacetone;3-hydroximinopentane-2,4-dione;3-hydroxyiminopentane-2,4-dione | | CAS: | 29917-12-2 | | MF: | C5H7NO3 | | MW: | 129.11 | | EINECS: | | | Product Categories: | ACETYLGROUP | | Mol File: | 29917-12-2.mol |  |
| | 2,3,4-Pentanetrione, 3-oxime (6CI,7CI,8CI,9CI) Chemical Properties |
| storage temp. | 2-8°C, sealed storage, away from moisture | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C5H7NO3/c1-3(7)5(6-9)4(2)8/h9H,1-2H3 | | InChIKey | VHMFUIWQKYCNMG-UHFFFAOYSA-N | | SMILES | CC(=O)/C(=N/O)/C(=O)C |
| HazardClass | IRRITANT | | HS Code | 2922500090 |
| | 2,3,4-Pentanetrione, 3-oxime (6CI,7CI,8CI,9CI) Usage And Synthesis |
| | 2,3,4-Pentanetrione, 3-oxime (6CI,7CI,8CI,9CI) Preparation Products And Raw materials |
|