| Company Name: |
Varanous Labs Pvt Ltd
|
| Tel: |
+91-7036248882 |
| Email: |
bheemashankar.e@varanouslabs.com |
| Products Intro: |
Product Name:2-Amino Flubendazole
CAS:82050-13-3
Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
| Company Name: |
Shandong Xiya Chemical Co., Ltd
|
| Tel: |
13355009207 13355009207 |
| Email: |
3007715519@qq.com |
| Products Intro: |
CAS:82050-13-3
Purity:>=98.0% Package:10MG
|
|
| | 2-AMINOFLUBENDAZOLE Basic information |
| Product Name: | 2-AMINOFLUBENDAZOLE | | Synonyms: | 2-AMINOFLUBENDAZOLE;(2-amino-3~{H}-benzimidazol-5-yl)-(4-fluorophenyl)methanone;Flubendazole Metabolite R35475 Standard;Methanone, (2-amino-1H-benzimidazol-6-yl)(4-fluorophenyl)-;Flubendazole Impurity 2 (Flubendazole EP Impurity B);(2-Amino-1H-benzimidazol-6-yl)(4-fluorophenyl)-methanone;2-AminoflubendazoleQ: What is
2-Aminoflubendazole Q: What is the CAS Number of
2-Aminoflubendazole Q: What is the storage condition of
2-Aminoflubendazole Q: What are the applications of
2-Aminoflubendazole;Flubendazole Impurity 1 | | CAS: | 82050-13-3 | | MF: | C14H10FN3O | | MW: | 255.25 | | EINECS: | | | Product Categories: | | | Mol File: | 82050-13-3.mol |  |
| | 2-AMINOFLUBENDAZOLE Chemical Properties |
| Melting point | approximate 249℃ (dec.) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | color | Pale Yellow | | BRN | 8849496 | | Major Application | clinical testing | | InChI | 1S/C14H10FN3O/c15-10-4-1-8(2-5-10)13(19)9-3-6-11-12(7-9)18-14(16)17-11/h1-7H,(H3,16,17,18) | | InChIKey | WINHLTQNRABBSW-UHFFFAOYSA-N | | SMILES | Nc1nc2cc(ccc2[nH]1)C(=O)c3ccc(F)cc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-AMINOFLUBENDAZOLE Usage And Synthesis |
| Uses | The hydrolyzed form of Flubendazole (F418500), which is an anthelmintic. |
| | 2-AMINOFLUBENDAZOLE Preparation Products And Raw materials |
|